CAS Number20781-21-9
Synonyms2,4-BIS(1,1,2,2-TETRAFLUOROETHYL)-6-PHENYLPYRIMIDINE; EINECS 244-036-7; 1-(2,4-Dimethoxyphenyl)methanamine hydrochloride (1:1); Benzenemethanamine, 2,4-dimethoxy-, hydrochloride (1:1); Benzenemethanamine, 2,4-dimethoxy-, hydrochloride; 2,4-DIMETHOXY-BENZYLAMINE HCL; MFCD00012854; (2,4-dimethoxyphenyl)methylamine,chloride; (2,4-Dimethoxyphenyl)methanamine hydrochloride; 2,4-Dimethoxybenzylamine hydrochloride; 2,4-dimethoxybenzyl amine hydrogen chloride; 2,4-dimethoxy-benzenemethanamine,hydrochloride
Molecular FormulaC9H14O2N1Cl1
Molecular Weight203.67
Purity98.00%
Density1.062g/cm3
Boiling Point271ºC at 760 mmHg
Melting Point188-190 °C(lit.)
AppearanceWhite to light yellow crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 20781-21-9 |
| Catalog No. | 2A-9038528 |
| Chinese Name | 2,4-二甲氧基苄胺盐酸盐 |
| Synonyms | 2,4-BIS(1,1,2,2-TETRAFLUOROETHYL)-6-PHENYLPYRIMIDINE; EINECS 244-036-7; 1-(2,4-Dimethoxyphenyl)methanamine hydrochloride (1:1); Benzenemethanamine, 2,4-dimethoxy-, hydrochloride (1:1); Benzenemethanamine, 2,4-dimethoxy-, hydrochloride; 2,4-DIMETHOXY-BENZYLAMINE HCL; MFCD00012854; (2,4-dimethoxyphenyl)methylamine,chloride; (2,4-Dimethoxyphenyl)methanamine hydrochloride; 2,4-Dimethoxybenzylamine hydrochloride; 2,4-dimethoxybenzyl amine hydrogen chloride; 2,4-dimethoxy-benzenemethanamine,hydrochloride |
| Molecular Formula | C9H14O2N1Cl1 |
| Molecular Weight | 203.67 |
| Purity | 98.00 |
| Density | 1.062g/cm3 |
| Boiling Point | 271ºC at 760 mmHg |
| Melting Point | 188-190 °C(lit.) |
| Appearance | White to light yellow crystal powder |
| Storage Condition | -20℃ |
| HTC | 2922299090 |
| MDL Number | MFCD00012854 |
| SMILES | COc1ccc(CN)c(OC)c1.Cl |
| InChI | InChI=1S/C9H13NO2.ClH/c1-11-8-4-3-7(6-10)9(5-8)12-2;/h3-5H,6,10H2,1-2H3;1H |
| InChI Key | KJOWSAVFSCSBMZ-UHFFFAOYSA-N |
| MSDS | msds/38528_1_20781_21_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dibromoquinoline | 20151-40-0 | 2A-9038319 |
| 2,4-Dibromophenyl glycidyl ether | 20217-01-0 | 2A-9038336 |
| 2,4-Dimethoxyiodobenzene | 20469-63-0 | 2A-9038424 |
| 2,4,5-Trimethyloxazole | 20662-84-4 | 2A-9038478 |
| 2,4-Dimethoxybenzylamine | 20781-20-8 | 2A-9038527 |
| Bis(2,4-dimethoxybenzyl)amine | 20781-23-1 | 2A-9038530 |
| 5-Bromo-2,4-dichloro-6-methylpyrimidine | 56745-01-8 | 2A-9038642 |
| (+)-Abscisic acid | 21293-29-8 | 2A-0201990 |
| 2,4-Dimethylaniline hydrochloride | 21436-96-4 | 2A-9038683 |
| N-[2-(Phenylmethyl)phenyl]-2-chloroacetamide | 21535-43-3 | 2A-9038695 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS