CAS Number20582-55-2
SynonymsEthyl 4-methyl-1,3-thiazole-5-carboxylate; Ethyl 4-methyl-5-thiazoleactate; Thiazole-5-carboxylic acid, 4-methyl-, ethyl ester; MFCD00626873; Ethyl 4-methylthiazole-5-carboxylate; 4-Methyl-thiazole-5-carboxylic acid ethyl ester; 5-Thiazolecarboxylic acid, 4-methyl-, ethyl ester; Ethyl 4-methyl-5-thiazolyl formate; 4-methyl-5-thiazole carboxylicacid ethylester
Molecular FormulaC7H9NO2S
Molecular Weight171.217
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point239.1±20.0 °C at 760 mmHg
Melting Point28 °C
AppearanceWhite to light yellow crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 20582-55-2 |
| Catalog No. | 2A-9038454 |
| Chinese Name | 4-甲基噻唑-5-甲酸乙酯 |
| Synonyms | Ethyl 4-methyl-1,3-thiazole-5-carboxylate; Ethyl 4-methyl-5-thiazoleactate; Thiazole-5-carboxylic acid, 4-methyl-, ethyl ester; MFCD00626873; Ethyl 4-methylthiazole-5-carboxylate; 4-Methyl-thiazole-5-carboxylic acid ethyl ester; 5-Thiazolecarboxylic acid, 4-methyl-, ethyl ester; Ethyl 4-methyl-5-thiazolyl formate; 4-methyl-5-thiazole carboxylicacid ethylester |
| Molecular Formula | C7H9NO2S |
| Molecular Weight | 171.217 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 239.1±20.0 °C at 760 mmHg |
| Melting Point | 28 °C |
| Appearance | White to light yellow crystal powder |
| Storage Condition | 2-8°C |
| HTC | 2934100090 |
| SMILES | CCOC(=O)c1scnc1C |
| InChI | InChI=1S/C7H9NO2S/c1-3-10-7(9)6-5(2)8-4-11-6/h4H,3H2,1-2H3 |
| InChI Key | WISQBJLUORKXNY-UHFFFAOYSA-N |
| MSDS | msds/38454_1_20582_55_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-p-Tolylpyrazole | 20518-17-6 | 2A-9038435 |
| 2,3,4,5-Tetrahydro-1H-pyrido[4,3-b]indole hydrochloride | 20522-30-9 | 2A-9038437 |
| 5-Iodobenzo[b]thiophene | 20532-38-1 | 2A-9038440 |
| 6-Methoxyguanine | 20535-83-5 | 2A-9038441 |
| 2-Hydroxy-3-cyanopyridine | 20577-27-9 | 2A-9038453 |
| 1-Methyl-4-piperidinemethanol | 20691-89-8 | 2A-9038489 |
| Methyl 5-amino-1-benzothiophene-2-carboxylate | 20699-85-8 | 2A-9038493 |
| 5-Bromobenzo[c]isothiazole | 20712-07-6 | 2A-9038496 |
| 2-Hydroxy-5-methylpyrazine | 20721-17-9 | 2A-9038498 |
| 2-Hydroxy-6-methylpyrazine | 20721-18-0 | 2A-9038499 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS