
CAS Number20469-61-8
SynonymsTrimethylanisole; EINECS 243-843-1; 2,3,4,6-TETRA-O-PIVALOYL-D-MANNOPYRANOSYL FLUORIDE; Methyl 2,3,5-trimethylphenyl ether; 4-methoxy-2,3,6-trimethylbenzene; 2,3,5-trimethylanisol; 2,3,5-trimethyl anisole; MFCD00142783; 2,3,5-TRIMETHYLANISOLE; Anisole, 2,3,5-trimethyl; 1-Methoxy-2,3,5-trimethylbenzol; 1-METHOXY-2,3,5-TRIMETHYL-BENZENE; 1-Methoxy-2,3,5-trimethylbenzene
Molecular FormulaC10H14O
Molecular Weight150.218
Purity98.00%
Density0.9±0.1 g/cm3
Boiling Point220.9±9.0 °C at 760 mmHg
AppearanceColorless oil
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 20469-61-8 |
| Catalog No. | 2A-9038423 |
| Chinese Name | 2,3,5-三甲基苯甲醚 |
| Synonyms | Trimethylanisole; EINECS 243-843-1; 2,3,4,6-TETRA-O-PIVALOYL-D-MANNOPYRANOSYL FLUORIDE; Methyl 2,3,5-trimethylphenyl ether; 4-methoxy-2,3,6-trimethylbenzene; 2,3,5-trimethylanisol; 2,3,5-trimethyl anisole; MFCD00142783; 2,3,5-TRIMETHYLANISOLE; Anisole, 2,3,5-trimethyl; 1-Methoxy-2,3,5-trimethylbenzol; 1-METHOXY-2,3,5-TRIMETHYL-BENZENE; 1-Methoxy-2,3,5-trimethylbenzene |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.218 |
| Purity | 98.00 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 220.9±9.0 °C at 760 mmHg |
| Appearance | Colorless oil |
| Storage Condition | Store at normal temperature and pressure |
| HTC | 2909309090 |
| SMILES | COc1cc(C)cc(C)c1C |
| InChI | InChI=1S/C10H14O/c1-7-5-8(2)9(3)10(6-7)11-4/h5-6H,1-4H3 |
| InChI Key | AWONIZVBKXHWJP-UHFFFAOYSA-N |
| MSDS | msds/38423_1_20469_61_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tris(4-nitrophenyl)amine | 20440-93-1 | 2A-9038412 |
| 2,6-Dichlorobenzyl bromide | 20443-98-5 | 2A-9038416 |
| Bornaprine | 20448-86-6 | 2A-9038418 |
| Melittin | 20449-79-0 | 2A-9038419 |
| Phenyl vinyl sulfoxide | 20451-53-0 | 2A-9038420 |
| Ethyl 4-methylcinnamate | 20511-20-0 | 2A-9038432 |
| Methyl (E)-3-pentenoate | 20515-19-9 | 2A-9038434 |
| 1-Benzothiophen-5-amine | 20532-28-9 | 2A-9038438 |
| Paederoside | 20547-45-9 | 2A-9038443 |
| Parthenolide | 20554-84-1 | 2A-9038444 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA