
CAS Number20440-91-9
Synonyms4-nitro-4',4''-dimethoxytriphenylamine; 4,4'-Dimethoxy-4''-nitrotriphenylamine; bis-(4-methoxy-phenyl)-(4-nitro-phenyl)-amine; 4-Methoxy-N-(4-methoxyphenyl)-N-(4-nitrophenyl)aniline; 4-nitro-N,N-di(4-methoxyphenyl)benzenamine; 4-Nitro-4',4'-dimethoxy-triphenylamin; Bis-(4-methoxy-phenyl)-(4-nitro-phenyl)-amin
Molecular FormulaC20H32N5O5P
Molecular Weight453.482
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point518.6±45.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 20440-91-9 |
| Catalog No. | 2A-9038410 |
| Chinese Name | 4-硝基-4',4''-二甲氧基三苯胺 |
| Synonyms | 4-nitro-4',4''-dimethoxytriphenylamine; 4,4'-Dimethoxy-4''-nitrotriphenylamine; bis-(4-methoxy-phenyl)-(4-nitro-phenyl)-amine; 4-Methoxy-N-(4-methoxyphenyl)-N-(4-nitrophenyl)aniline; 4-nitro-N,N-di(4-methoxyphenyl)benzenamine; 4-Nitro-4',4'-dimethoxy-triphenylamin; Bis-(4-methoxy-phenyl)-(4-nitro-phenyl)-amin |
| Molecular Formula | C20H32N5O5P |
| Molecular Weight | 453.482 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 518.6±45.0 °C at 760 mmHg |
| HTC | 2922299090 |
| MDL Number | MFCD00586295 |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI Key | IRTXFNPBVZYVOU-UHFFFAOYSA-N |
| MSDS | msds/38410_1_20440_91_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Aminopyrrolidin-2-one hydrochloride | 20386-22-5 | 2A-9038400 |
| 5-Chloropentyl acetate | 20395-28-2 | 2A-9038401 |
| 5-Thio-D-glucose | 20408-97-3 | 2A-9038404 |
| Deprodone | 20423-99-8 | 2A-9038406 |
| Ruthenium tetraoxide | 20427-56-9 | 2A-9038407 |
| 4-Nitro-N,N-bis(4-methylphenyl)benzenamine | 20440-92-0 | 2A-9038411 |
| Tris(4-nitrophenyl)amine | 20440-93-1 | 2A-9038412 |
| 2,6-Dichlorobenzyl bromide | 20443-98-5 | 2A-9038416 |
| Bornaprine | 20448-86-6 | 2A-9038418 |
| Melittin | 20449-79-0 | 2A-9038419 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA