
CAS Number19472-74-3
Synonyms2-bromobenzeneacetonitrile; EINECS 243-091-4; 2-(2'-bromophenyl)-acetonitrile; brombenzyl cyanide; 2-(o-bromophenyl)acetonitrile; o-Bromobenzyl cyanide; 2-Bromobenzylnitrile; (2-Bromophenyl)acetonitrile; o-Bromobenzyl; 2-Bromobenzyl cyanid; 2-Bromophenylacetonitrile; o-Bromobenbenzylcyanide; MFCD00001896; O-BROMOPHENYLACETONITRILE
Molecular FormulaC8H6BrN
Molecular Weight196.044
Purity98.00%
Density1.5±0.1 g/cm3
Boiling Point269.5±0.0 °C at 760 mmHg
Melting Point1 °C
AppearanceTransparent to yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 19472-74-3 |
| Catalog No. | 2A-9038134 |
| Chinese Name | 邻溴氰苄 |
| Synonyms | 2-bromobenzeneacetonitrile; EINECS 243-091-4; 2-(2'-bromophenyl)-acetonitrile; brombenzyl cyanide; 2-(o-bromophenyl)acetonitrile; o-Bromobenzyl cyanide; 2-Bromobenzylnitrile; (2-Bromophenyl)acetonitrile; o-Bromobenzyl; 2-Bromobenzyl cyanid; 2-Bromophenylacetonitrile; o-Bromobenbenzylcyanide; MFCD00001896; O-BROMOPHENYLACETONITRILE |
| Molecular Formula | C8H6BrN |
| Molecular Weight | 196.044 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 269.5±0.0 °C at 760 mmHg |
| Melting Point | 1 °C |
| Appearance | Transparent to yellow liquid |
| Storage Condition | Sealed at room temperature, protected from light, |
| Packaging | I |
| HTC | 2926909090 |
| SMILES | N#CCc1ccccc1Br |
| InChI | InChI=1S/C8H6BrN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5H2 |
| InChI Key | BVCOJESIQPNOIF-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/38134_2_19472_74_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Acetylamino-2-(diethylamino)anisole | 19433-93-3 | 2A-9038120 |
| N-[3-[(2-Cyanoethyl)ethylamino]-4-methoxyphenyl]acetamide | 19433-94-4 | 2A-9038121 |
| Bis(2-pyridyl) ketone | 19437-26-4 | 2A-9038125 |
| Methyl 3-hydroxybenzoate | 19438-10-9 | 2A-9038126 |
| Rubrosterone | 19466-41-2 | 2A-9038133 |
| N-Methyl-4-nitrobenzylamine hydrochloride | 19499-60-6 | 2A-9038140 |
| (3-Nitrobenzyl)methylamine | 19499-61-7 | 2A-9038141 |
| 3-Methoxy-2-methylaniline | 19500-02-8 | 2A-9038142 |
| 4-Methoxyphenylhydrazine hydrochloride | 19501-58-7 | 2A-9038143 |
| Manganese triacetate dihydrate | 19513-05-4 | 2A-9038145 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA