
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 19434-35-6 |
| Catalog No. | 2A-9038123 |
| Chinese Name | 2-对-甲苯基氧苯甲醛 |
| Synonyms | methylphenoxybenzenecarbaldehyde; MFCD01568738 |
| Molecular Formula | C14H11ClO2 |
| Molecular Weight | 212.24400 |
| Purity | 98.00 |
| Density | 1.129g/cm3 |
| Boiling Point | 316.5ºC at 760mmHg |
| Melting Point | 52-54ºC |
| Storage Condition | Sealed at room temperature, protected from light, |
| HTC | 2912499000 |
| MDL Number | MFCD08446942 |
| SMILES | O=C([H])C1=CC=C(C=C1)OC2=CC(C)=C(Cl)C=C2 |
| InChI | 1S/C14H11ClO2/c1-10-8-13(6-7-14(10)15)17-12-4-2-11(9-16)3-5-12/h2-9H,1H3 |
| InChI Key | SOUQMHCBVSIYKA-UHFFFAOYSA-N |
| UNSPSC | 12352100 |
| MSDS | msds/38123_1_19434_35_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Chloromethyl pivalate | 18997-19-8 | 2A-9037992 |
| 4-Methylbenzamide oxime | 19227-13-5 | 2A-9038053 |
| 5-Fluoro-2-methoxybenzaldehyde | 19415-51-1 | 2A-9038109 |
| 2-[4-(Trifluoromethyl)phenoxy]ethanethioamide | 19432-91-8 | 2A-9038119 |
| 2-Phenoxybenzaldehyde | 19434-34-5 | 2A-9038122 |
| 7-Bromobenzo[1,3]dioxole-5-carbaldehyde | 19522-96-4 | 2A-9038147 |
| 3-Bromo-5-chlorosalicylaldehyde | 19652-32-5 | 2A-9038165 |
| 2-Methoxy-6-nitrobenzaldehyde | 19689-88-4 | 2A-9038175 |
| 6,7-Dihydrobenzo[b]thiophen-4(5H)-oneoxime | 19995-19-8 | 2A-9038278 |
| Tolyl diiodomethyl sulfone | 20018-09-1 | 2A-9038287 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA