
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13335-73-4 |
| Catalog No. | 2A-9003810 |
| Chinese Name | 3,4-二甲基苯氧基乙酸 |
| Synonyms | 3,4-Dimethylphenoxyacetic acid |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20000 |
| Purity | 97 |
| Density | 1.146 g/cm3 |
| Boiling Point | 323.5ºC at 760 mmHg |
| Melting Point | 164-166°C |
| Storage Condition | Sealed at room temperature, cool, ventilated and d |
| HTC | 2918990090 |
| SMILES | Cc1ccc(OCC(=O)O)cc1C |
| InChI | InChI=1S/C10H12O3/c1-7-3-4-9(5-8(7)2)13-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12) |
| InChI Key | GIEQJKZWTIFEJM-UHFFFAOYSA-N |
| MSDS | msds/3810_1_13335_73_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,4-Dimethoxyphenol | 2033-89-8 | 2A-9003802 |
| 3,4-Dimethoxythiophenol | 700-96-9 | 2A-9003805 |
| 3,4-Dimethylbenzenethiol | 18800-53-8 | 2A-9003807 |
| 3,4-Dimethylbenzophenone | 2571-39-3 | 2A-9003808 |
| 3,4-Dimethylbenzyl alcohol | 6966-10-5 | 2A-9003809 |
| 3,4-Dinitrobenzoic acid | 528-45-0 | 2A-9003811 |
| 3,4-Dinitrophenol | 577-71-9 | 2A-9003812 |
| 3,4-Methylendioxyphenol | 533-31-3 | 2A-9003815 |
| 3,5,6-Trichlorosalicylic acid | 40932-60-3 | 2A-9003817 |
| 3,5-Diacethoxybenzoic acid | 35354-29-1 | 2A-9003850 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA