![3,4-Dihydro-5,9-dihydroxy-8-methoxy-2,2-dimethyl-7-(3-methyl-2-butenyl)-2H,6H-pyrano[3,2-b]xanthen-6-one structure, CAS 19275-46-8](/structures/40000/38064_1_19275_46_8.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 19275-46-8 |
| Catalog No. | 2A-9038064 |
| Chinese Name | 3-异倒捻子素 |
| Synonyms | 9-hydroxycalabaxanthone |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 615.9±55.0 °C at 760 mmHg |
| Melting Point | 155-160ºC |
| Appearance | light yellow crystal |
| Storage Condition | 2-8°C, sealed, dry |
| Application | 3-Isomangostin, extracted from Garciniamangostana.L. shell, is a potent MutT homolog 1 (MTH1) inhibitor with an IC50 value of 52 nM. 3-Isomangostin can be used to develop anticancer agents. |
| MDL Number | MFCD10566618 |
| SMILES | COc1c(O)cc2oc3cc4c(c(O)c3c(=O)c2c1CC=C(C)C)CCC(C)(C)O4 |
| InChI Key | KJCDBAVVDILRMP-UHFFFAOYSA-N |
| MSDS | msds/38064_1_19275_46_8.pdf |
| Transport Info | Product name: β-isomangostin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,3-Dichloro-2-iodobenzene | 19230-28-5 | 2A-9038054 |
| Dichlorobis(trimethylphosphine)nickel(II) | 19232-05-4 | 2A-9038056 |
| Praseodymium(III) isopropoxide | 19236-14-7 | 2A-9038058 |
| Neodymium(III) isopropoxide | 19236-15-8 | 2A-9038059 |
| N,N-Diacetoxyethylaniline | 19249-34-4 | 2A-9038062 |
| 2-[(2-Nitrophenyl)thio]aniline | 19284-81-2 | 2A-9038066 |
| (1-Methyl-1H-indol-3-yl)methylamine | 19293-60-8 | 2A-9038069 |
| Cardamonin | 19309-14-9 | 2A-9038071 |
| 6-Hydroxy-2(1H)-quinolinone | 19315-93-6 | 2A-9038073 |
| Tetraethyleneglycol monooctyl ether | 19327-39-0 | 2A-9038075 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA