
CAS Number18677-48-0
SynonymsPyridine,3,5-dimethoxy; 3,5-dimethoxy-pyridine; 3,5-Dimethoxypyridine; 3.5-Dimethoxy-pyridin
Molecular FormulaC7H9NO2
Molecular Weight139.15
Purity98.00%
Density1.1±0.1 g/cm3
Boiling Point225.6±20.0 °C at 760 mmHg
AppearanceColorless to light yellow oil
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18677-48-0 |
| Catalog No. | 2A-9037891 |
| Chinese Name | 3,5-二甲氧基吡啶 |
| Synonyms | Pyridine,3,5-dimethoxy; 3,5-dimethoxy-pyridine; 3,5-Dimethoxypyridine; 3.5-Dimethoxy-pyridin |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 225.6±20.0 °C at 760 mmHg |
| Appearance | Colorless to light yellow oil |
| Storage Condition | Refrigerator |
| HTC | 2933399090 |
| PubChem ID | 7650540 |
| SMILES | COc1cncc(OC)c1 |
| InChI | InChI=1S/C7H9NO2/c1-9-6-3-7(10-2)5-8-4-6/h3-5H,1-2H3 |
| InChI Key | LPFKVVZTNDJALE-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Amino-2-fluoropyridine | 18614-51-2 | 2A-9037864 |
| 4-Hydroxy-2-methylpyridine | 18615-86-6 | 2A-9037865 |
| 6-Sulfopyridine-2-carboxylic acid | 18616-02-9 | 2A-9037866 |
| 1-(Diphenylmethyl)-3-hydroxyazetidine | 18621-17-5 | 2A-9037868 |
| 2-Isobutylthiazole | 18640-74-9 | 2A-9037874 |
| 2-Methyl-3-nitropyridine | 18699-87-1 | 2A-9037900 |
| 4-Bromo-6-chloro-2-(trifluoromethyl)quinoline | 18706-32-6 | 2A-9037906 |
| 4-Bromo-6-methoxy-2-(trifluoromethyl)quinoline | 18706-38-2 | 2A-9037907 |
| 4-Methylpyrrole-2-carboxylic acid | 18711-59-6 | 2A-9037910 |
| 1-[(4-Chlorophenyl)benzyl]piperazine dihydrochloride | 18719-22-7 | 2A-9037913 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA