
Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18649-93-9 |
| Catalog No. | 2A-9037879 |
| Chinese Name | 泽泻醇B |
| Synonyms | (5α,8α,9β,11β,14β,23S,24S)-11,23-Dihydroxy-8,14-dimethyl-24,25-epoxy-18-norcholest-13(17)-en-3-one |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.70 |
| Purity | ≥90.0 (HPLC) |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 567.1±50.0 °C at 760 mmHg |
| Appearance | solid |
| Storage Condition | -20℃ |
| Application | Alisol B is a potential new compound for the treatment of orthopedic diseases that exerts its function through the differentiation of osteoclasts. |
| PubChem ID | 96023808 |
| MDL Number | MFCD24369682 |
| SMILES | O1[C@@H](C1(C)C)[C@@H](O)C[C@@H](C)C2=C3[C@@]([C@@]4([C@H]([C@@]5([C@@H](CC4)C(C(=O)CC5)(C)C)C)[C@H](C3)O)C)(CC2)C |
| InChI | 1S/C30H48O4/c1-17(15-21(32)25-27(4,5)34-25)18-9-13-29(7)19(18)16-20(31)24-28(6)12-11-23(33)26(2,3)22(28)10-14-30(24,29)8/h17,20-22,24-25,31-32H,9-16H2,1-8H3/t17-,20+,21+,22+,24+,25-,28+,29+,30+/m1/s1 |
| InChI Key | GBJKHDVRXAVITG-UNPOXIGHSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/37879_1_18649_93_9.pdf |
| Transport Info | Product name: Alistagol B |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Ethoxybenzamidine hydrochloride | 18637-00-8 | 2A-9037872 |
| 3,4,5-Trimethoxybenzylamine | 18638-99-8 | 2A-9037873 |
| Chloro(dimethyl)octadecylsilane | 18643-08-8 | 2A-9037876 |
| Dimethyl chloroterephthalate | 18643-84-0 | 2A-9037877 |
| Dimethyl 2-bromoterephthalate | 18643-86-2 | 2A-9037878 |
| Triformylmethane | 18655-47-5 | 2A-9037882 |
| Nitrilotriacetic acid trisodium salt monohydrate | 18662-53-8 | 2A-9037884 |
| 3-Aminopentanoic acid | 18664-78-3 | 2A-9037886 |
| Ambroxol | 18683-91-5 | 2A-9037893 |
| 2-Mercapto-1,3,4-thiadiazol | 18686-82-3 | 2A-9037894 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA