
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18605-26-0 |
| Catalog No. | 2A-9037861 |
| Chinese Name | N-Cbz-beta-丙氨酸叔丁酯 |
| Synonyms | N-Cbz-beta-alanine tert-butyl ester |
| Molecular Formula | C15H21O4N1 |
| Molecular Weight | 279.34 |
| Purity | 98.00 |
| Density | 1.101 |
| Boiling Point | 409.3ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2924299090 |
| PubChem ID | 6754593 |
| MDL Number | MFCD03837779 |
| SMILES | CC(C)(C)OC(=O)CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H21NO4/c1-15(2,3)20-13(17)9-10-16-14(18)19-11-12-7-5-4-6-8-12/h4-8H,9-11H2,1-3H3,(H,16,18) |
| InChI Key | RLEOEDXSMUQCMZ-UHFFFAOYSA-N |
| MSDS | msds/37861_1_18605_26_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| 8-Bromo-1,6-naphthyridine | 17965-74-1 | 2A-9037687 |
| Methyl indolyl-3-glyoxylate | 18372-22-0 | 2A-9037790 |
| (R)-(+)-1,1'-Bi-2-naphthol | 18531-94-7 | 2A-9037840 |
| (S)-(-)-2,2'-Diamino-1,1'-binaphthalene | 18531-95-8 | 2A-9037841 |
| (S)-(-)-1,1'-Bi-2-naphthol | 18531-99-2 | 2A-9037842 |
| (R)-Piperidine-2-carboxylic acid methyl ester hydrochloride | 18650-38-9 | 2A-9037881 |
| 5-Bromo-4-chloro-3-indolyl-beta-D-glucuronide cyclohexylammonium salt | 18656-96-7 | 2A-9037883 |
| 4-(Methoxycarbonyl)bicyclo[2.2.2]octane-1-carboxylic acid | 18720-35-9 | 2A-9037914 |
| (R)-(+)-2,2'-Diamino-1,1'-binaphthalene | 18741-85-0 | 2A-9037917 |
| 4-tert-Butoxycarbonylamino-4-carbamoylbutyric acid | 18800-74-3 | 2A-9037934 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA