
CAS Number18496-54-3
Synonyms4-PHENYLBUTYRYL CHLORIDE; 4-Phenylbutanoylchloride; MFCD00798080; 4-phenyl-n-butyryl chloride; 4-phenylpropanoic acid chloride; 4-phenylbutanoic acid chloride; 4-phenylbutyric acid chloride; 4-phenylbutyric acid cloride; 4-phenyl-Mutanoyl Chloride
Molecular FormulaC10H11ClO
Molecular Weight182.65
Purity98.00%
Density1.115g/cm3
Boiling Point262.6ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18496-54-3 |
| Catalog No. | 2A-9037829 |
| Chinese Name | 4-苯基丁酰氯 |
| Synonyms | 4-PHENYLBUTYRYL CHLORIDE; 4-Phenylbutanoylchloride; MFCD00798080; 4-phenyl-n-butyryl chloride; 4-phenylpropanoic acid chloride; 4-phenylbutanoic acid chloride; 4-phenylbutyric acid chloride; 4-phenylbutyric acid cloride; 4-phenyl-Mutanoyl Chloride |
| Molecular Formula | C10H11ClO |
| Molecular Weight | 182.65 |
| Purity | 98.00 |
| Density | 1.115g/cm3 |
| Boiling Point | 262.6ºC at 760mmHg |
| Water Solubility | It reacts with water. |
| Storage Condition | Sealed at room temperature, protected from light, |
| Packaging | II |
| HTC | 2916399090 |
| PubChem ID | 16902677 |
| SMILES | O=C(Cl)CCCc1ccccc1 |
| InChI | InChI=1S/C10H11ClO/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| InChI Key | VQDQISMDUHBUFF-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Phenylpyrrolidin-3-amine | 18471-41-5 | 2A-9037817 |
| 4-(2-Pyridyl)aniline | 18471-73-3 | 2A-9037818 |
| 3,7-Dimethyl-1-octen-3-ol | 18479-49-7 | 2A-9037822 |
| 2,6-Dimethyl-7-octen-2-ol | 18479-58-8 | 2A-9037823 |
| Platinum nitrate | 18496-40-7 | 2A-9037828 |
| Chloroplatinic acid hexahydrate | 18497-13-7 | 2A-9037830 |
| [1,2-Bis(diphenyphosphino)ethane]dichlorocobalt(II) | 18498-01-6 | 2A-9037831 |
| 1,1-Diisopropoxytrimethylamine | 18503-89-4 | 2A-9037832 |
| 1,1-Dibutoxytrimethylamine | 18503-90-7 | 2A-9037833 |
| (2,3-Dihydrobenzo[1,4]dioxin-2-yl)acetonitrile | 18505-91-4 | 2A-9037834 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA