
CAS Number18361-03-0
Synonyms3,4-Ethylenedioxythiophene-2,5-dicarboxylic Acid; 2,5-Dicarboxylic acid-3,4-ethylene dioxythiophene; 3,4-ethylenedioxythiophenedicarboxylic acid; Thieno[3,4-B]-1,4-Dioxin-5,7-DicarboxylicAcid,2,3-Dihydro; 3,4-ethylenedioxy-2,5-dicarboxythiophene; 3,4-ethylenedioxythiophene-2,5-dicarboxyllic acid; 2,3-Dihydro-thieno[3,4-b]-p-dioxin-5,7-dicarboxylic acid; 2,5-dicarboxy-3,4-ethylenedioxythiophene; 3,4-Ethylendioxythiophen-2,5-dicarbonsure; 3,4-ethylenedioxythiophene-2,5-dicarboxylic acid; 3,4-ETHYLENEDIOXOTHIOPHENE-2,5-DICARBOXYLIC ACID
Molecular FormulaC8H6O6S1
Molecular Weight230.2
Purity98.00%
Density1.732 g/cm3
Boiling Point482.6ºC at 760 mmHg
AppearanceSolid;White to Light yellow powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18361-03-0 |
| Catalog No. | 2A-9037781 |
| Chinese Name | 2,5-二羧酸-3,4-乙撑二氧噻吩 |
| Synonyms | 3,4-Ethylenedioxythiophene-2,5-dicarboxylic Acid; 2,5-Dicarboxylic acid-3,4-ethylene dioxythiophene; 3,4-ethylenedioxythiophenedicarboxylic acid; Thieno[3,4-B]-1,4-Dioxin-5,7-DicarboxylicAcid,2,3-Dihydro; 3,4-ethylenedioxy-2,5-dicarboxythiophene; 3,4-ethylenedioxythiophene-2,5-dicarboxyllic acid; 2,3-Dihydro-thieno[3,4-b]-p-dioxin-5,7-dicarboxylic acid; 2,5-dicarboxy-3,4-ethylenedioxythiophene; 3,4-Ethylendioxythiophen-2,5-dicarbonsure; 3,4-ethylenedioxythiophene-2,5-dicarboxylic acid; 3,4-ETHYLENEDIOXOTHIOPHENE-2,5-DICARBOXYLIC ACID |
| Molecular Formula | C8H6O6S1 |
| Molecular Weight | 230.2 |
| Purity | 98.00 |
| Density | 1.732 g/cm3 |
| Boiling Point | 482.6ºC at 760 mmHg |
| Appearance | Solid;White to Light yellow powder to crystal |
| Water Solubility | Slightly soluble: dimethylformamide |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2934999090 |
| PubChem ID | 4683539 |
| MDL Number | MFCD00966477 |
| SMILES | O=C(O)c1sc(C(=O)O)c2c1OCCO2 |
| InChI | InChI=1S/C8H6O6S/c9-7(10)5-3-4(14-2-1-13-3)6(15-5)8(11)12/h1-2H2,(H,9,10)(H,11,12) |
| InChI Key | NWIYUAISDYJVMZ-UHFFFAOYSA-N |
| MSDS | msds/37781_1_18361_03_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-Methyl-5-nitropyrazole-4-carboxylic acid | 18213-77-9 | 2A-9037745 |
| 3-Methyl-5-nitroisoquinoline | 18222-17-8 | 2A-9037746 |
| 2-(1-Methylpropyl)-thiazole | 18277-27-5 | 2A-9037758 |
| 1-(4-Benzenesulfonic acid)pyrazole | 18336-38-4 | 2A-9037773 |
| 2-Amino-3-methyl-5-nitropyridine | 18344-51-9 | 2A-9037777 |
| 2-Hydroxy-3-bromo-4-methylpyridine | 18368-59-7 | 2A-9037784 |
| 3-Methyl-2-nitropyridine | 18368-73-5 | 2A-9037788 |
| Ethyl 4-chloroquinoline-2-carboxylate | 18436-69-6 | 2A-9037804 |
| 4-Chloro-6-methylquinoline | 18436-71-0 | 2A-9037805 |
| 4-Chloro-8-methylquinoline | 18436-73-2 | 2A-9037806 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA