CAS Number18306-29-1
SynonymsSulfuric acid,bis(trimethylsilyl); Bis(trimethylsilyl) sulphate; Sulfuric acid,TMS; bis(trimethylsilyl)sulfuric acid; Bis(trimethylsilyl) sulfate; EINECS 242-192-0; Bistrimethylsilylsulfate; MFCD00008268; Schwefelsaeure-bis-trimethylsilylester; sulfuric acid bis-trimethylsilanyl ester
Molecular FormulaC6H18O4SSi2
Molecular Weight242.44
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point239.4±0.0 °C at 760 mmHg
Melting Point41-44 °C(lit.)
AppearanceBeige to brown low melting point crystals
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18306-29-1 |
| Catalog No. | 2A-9037770 |
| Chinese Name | 双(三甲基硅)硫酸盐 |
| Synonyms | Sulfuric acid,bis(trimethylsilyl); Bis(trimethylsilyl) sulphate; Sulfuric acid,TMS; bis(trimethylsilyl)sulfuric acid; Bis(trimethylsilyl) sulfate; EINECS 242-192-0; Bistrimethylsilylsulfate; MFCD00008268; Schwefelsaeure-bis-trimethylsilylester; sulfuric acid bis-trimethylsilanyl ester |
| Molecular Formula | C6H18O4SSi2 |
| Molecular Weight | 242.44 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 239.4±0.0 °C at 760 mmHg |
| Melting Point | 41-44 °C(lit.) |
| Appearance | Beige to brown low melting point crystals |
| Water Solubility | Soluble in: benzene |
| Storage Condition | Sealed at room temperature, protected from light, |
| Packaging | III |
| HTC | 2931900090 |
| PubChem ID | 3139442 |
| SMILES | C[Si](C)(C)OS(=O)(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C6H18O4SSi2/c1-12(2,3)9-11(7,8)10-13(4,5)6/h1-6H3 |
| InChI Key | KRUQDZRWZXUUAD-UHFFFAOYSA-N |
| Hazard Symbols | 4.1 |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Division 1 Flammable solids. Sub-hazards: Category 8 Corrosives UN number: 2925 Proper shipping name: Flammable solid, corrosive, organic, not otherwise specified Packing grade: III |
| Related Products in Semiconductor Chemical Intermediates | ||
|---|---|---|
| 1-Iodo-2-(trimethylsilyl)acetylene | 18163-47-8 | 2A-9037730 |
| (Trimethylsilyl)methylamine | 18166-02-4 | 2A-9037731 |
| 1-(Trimethylsilyl)-1-pentyne | 18270-17-2 | 2A-9037757 |
| 1-Trimethylsilyl-1,2,4-triazole | 18293-54-4 | 2A-9037765 |
| 1,3-Bis(trimethylsilyl)urea | 18297-63-7 | 2A-9037767 |
| N,O-Bis(trimethylsilyl)trifluoroacetamide | 21149-38-2 | 2A-9038616 |
| O-(Trimethylsilyl)hydroxylamine | 22737-36-6 | 2A-9039063 |
| N-Methyl-N-(trimethylsilyl)trifluoroacetamide | 24589-78-4 | 2A-9039519 |
| Adamantylethyltrichlorosilane | 37843-11-1 | 2A-9042026 |
| 3-(Trimethylsilyl)propargyl bromide | 38002-45-8 | 2A-9042056 |
| Browse all Semiconductor Chemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS