
CAS Number18282-40-1
Synonyms1-Iodo-2-ethylbenzene; o-Iodoethylbenzene; o-ethyliodobenzene; Benzene,1-ethyl-2-iodo; 2-Ethyliodobenzene; 1-Ethyl-2-iodobenzene; MFCD00040871
Molecular FormulaC8H9I1
Molecular Weight232.06
Purity98.00%
Density1.618
Boiling Point64-65 °C (5 mmHg)
AppearanceColorless to light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18282-40-1 |
| Catalog No. | 2A-9037761 |
| Chinese Name | 1-乙基-2-碘苯 |
| Synonyms | 1-Iodo-2-ethylbenzene; o-Iodoethylbenzene; o-ethyliodobenzene; Benzene,1-ethyl-2-iodo; 2-Ethyliodobenzene; 1-Ethyl-2-iodobenzene; MFCD00040871 |
| Molecular Formula | C8H9I1 |
| Molecular Weight | 232.06 |
| Purity | 98.00 |
| Density | 1.618 |
| Boiling Point | 64-65 °C (5 mmHg) |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | Sealed at room temperature, protected from light, |
| HTC | 2903999090 |
| PubChem ID | 3140497 |
| MDL Number | MFCD00040871 |
| SMILES | CCc1ccccc1I |
| InChI | InChI=1S/C8H9I/c1-2-7-5-3-4-6-8(7)9/h3-6H,2H2,1H3 |
| InChI Key | ZEJZDNMOGNUIHL-UHFFFAOYSA-N |
| MSDS | msds/37761_1_18282_40_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tin(IV) phthalocyanine dichloride | 18253-54-8 | 2A-9037752 |
| Methyltrioctadecylammonium bromide | 18262-86-7 | 2A-9037753 |
| 2,2'-Dinitrodiphenylamine | 18264-71-6 | 2A-9037754 |
| Zirconium(IV) ethoxide | 18267-08-8 | 2A-9037755 |
| 3,6,9-Trioxaundecamethylene bis(2-ethylhexanoate) | 18268-70-7 | 2A-9037756 |
| 4-Iodobenzyl alcohol | 18282-51-4 | 2A-9037762 |
| 2-Aminoethylammonium chloride | 18299-54-2 | 2A-9037768 |
| Cyanoethyl sucrose | 18304-13-7 | 2A-9037769 |
| N-Ethylmethallylamine | 18328-90-0 | 2A-9037772 |
| 5alpha-Androst-16-en-3-one | 18339-16-7 | 2A-0201973 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA