
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17928-09-5 |
| Catalog No. | 2A-9037676 |
| Chinese Name | 4-甲基-5-噻唑乙胺盐酸盐 |
| Synonyms | 4-methyl-5-thiazoleethanamine hydrochloride |
| Molecular Formula | C9H14ClN3OS |
| Molecular Weight | 247.748 |
| Purity | 98.00 |
| Boiling Point | 244.8ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2934100090 |
| PubChem ID | 10266767 |
| MDL Number | MFCD03089419 |
| SMILES | Cc1ncsc1CCN.Cl |
| InChI | InChI=1S/C6H10N2S.ClH/c1-5-6(2-3-7)9-4-8-5;/h4H,2-3,7H2,1H3;1H |
| InChI Key | LUKLCJGBQDHGRL-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 6-Bromoindole-3-carboxaldehyde | 17826-04-9 | 2A-9037646 |
| 5-(Methoxycarbonyl)pyridine-2-carboxylic acid | 17874-79-2 | 2A-9037659 |
| 3-Amino-6-bromopyrazine-2-carboxamide | 17890-77-6 | 2A-9037662 |
| 4-Methoxy-2-methyl-1H-indole | 17897-50-6 | 2A-9037665 |
| 2-Amino-6-methoxypyridine | 17920-35-3 | 2A-9037672 |
| 7-Methylidenebicyclo[3.3.1]nonan-3-one | 17933-29-8 | 2A-9037680 |
| 6-Methoxy-1,2,3,4-tetrahydro-9H-pyrido[3,4-b]indole-1-carboxylic acid | 17952-63-5 | 2A-9037684 |
| Methyl 1-benzylazetidine-2-carboxylate | 18085-37-5 | 2A-9037712 |
| 6-Chloro-3-nitroimidazo[1,2-b]pyridazine | 18087-76-8 | 2A-9037714 |
| Carbonic acid 5-chloro-8-quinolyl ethyl ester | 18119-31-8 | 2A-9037719 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA