
CAS Number17697-12-0
Synonymsphenylseleninic anhydride; benzeneselenic acid anhydride; Benzeneseleninic acid anhydride; Bis(phenylseleninic) anhydride; EINECS 241-701-3; Benzeneseleninic anhydride; benzeneselenic anhydride; [PhSe(O)]2O; MFCD00001991
Molecular FormulaC12H10O3Se2
Molecular Weight360.12600
Purity98.00%
Boiling Point184.2ºC at 760 mmHg
Melting Point165-170 °C(lit.)
AppearanceWhite to light beige powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17697-12-0 |
| Catalog No. | 2A-9037598 |
| Chinese Name | 苯亚硒酸酐 |
| Synonyms | phenylseleninic anhydride; benzeneselenic acid anhydride; Benzeneseleninic acid anhydride; Bis(phenylseleninic) anhydride; EINECS 241-701-3; Benzeneseleninic anhydride; benzeneselenic anhydride; [PhSe(O)]2O; MFCD00001991 |
| Molecular Formula | C12H10O3Se2 |
| Molecular Weight | 360.12600 |
| Purity | 98.00 |
| Boiling Point | 184.2ºC at 760 mmHg |
| Melting Point | 165-170 °C(lit.) |
| Appearance | White to light beige powder |
| Storage Condition | Sealed at room temperature, protected from light, |
| Packaging | III |
| HTC | 2916399090 |
| PubChem ID | 3138372 |
| SMILES | O=[Se](O[Se](=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10O3Se2/c13-16(11-7-3-1-4-8-11)15-17(14)12-9-5-2-6-10-12/h1-10H |
| InChI Key | FHPZOWOEILXXBD-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Aminophenyl beta-D-lactopyranoside | 17691-02-0 | 2A-9037589 |
| Dropropizine | 17692-31-8 | 2A-9037590 |
| Vanitiolide | 17692-71-6 | 2A-9037591 |
| 1,1'-Diethyl-2,2'-quinotricarbocyanine iodide | 17695-32-8 | 2A-9037595 |
| 4-Methylumbelliferyl butyrate | 17695-46-4 | 2A-9037596 |
| Decaborane | 17702-41-9 | 2A-9037599 |
| 2-Aminodecanoic acid | 17702-88-4 | 2A-9037600 |
| (2-Chloroethoxy)cyclopropane | 17714-18-0 | 2A-9037601 |
| 5-Thiazolamine | 17721-00-5 | 2A-9037604 |
| 2-(2-Bromoethoxy)tetrahydro-2H-pyran | 17739-45-6 | 2A-9037608 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA