
CAS Number17672-26-3
Synonyms3-Hydrazinobenzonitrile; 3-Cyanophenylhydrazine hydrochloride; MFCD03030048; 3-hydrazinylbenzonitrile
Molecular FormulaC7H7N3
Molecular Weight133.15
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point301.5±25.0 °C at 760 mmHg
Melting Point190ºC
AppearanceWhite crystal/light yellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17672-26-3 |
| Catalog No. | 2A-9037580 |
| Chinese Name | 3-氰基苯肼盐酸盐 |
| Synonyms | 3-Hydrazinobenzonitrile; 3-Cyanophenylhydrazine hydrochloride; MFCD03030048; 3-hydrazinylbenzonitrile |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 301.5±25.0 °C at 760 mmHg |
| Melting Point | 190ºC |
| Appearance | White crystal/light yellow powder |
| Storage Condition | -20°C, protected from light, inert gas |
| HTC | 2928000090 |
| PubChem ID | 3206936 |
| MDL Number | MFCD03030048 |
| SMILES | N#Cc1cccc(NN)c1 |
| InChI | InChI=1S/C7H7N3/c8-5-6-2-1-3-7(4-6)10-9/h1-4,10H,9H2 |
| InChI Key | SBOSIWQIJOMACM-UHFFFAOYSA-N |
| MSDS | msds/37580_1_17672_26_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Sodium 3-mercaptopropanesulphonate | 17636-10-1 | 2A-9037571 |
| Methyl cyanoformate | 17640-15-2 | 2A-9037574 |
| D-Valine benzy ester 4-methylbenzenesulfonate | 17662-84-9 | 2A-9037576 |
| Betaine citrate | 17671-50-0 | 2A-9037577 |
| 6-Amino-2-methylphenol | 17672-22-9 | 2A-9037579 |
| 4-Hydrazinobenzonitrile | 17672-27-4 | 2A-9037581 |
| 2-Ethoxyphenylhydrazine | 17672-29-6 | 2A-9037582 |
| Guanylurea phosphate | 17675-60-4 | 2A-9037583 |
| Triiron dodecarbonyl | 17685-52-8 | 2A-9037586 |
| (Triacetoxy)ethylsilane | 17689-77-9 | 2A-9037588 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA