
CAS Number17609-80-2
SynonymsEINECS 241-583-3; 2-chloro-4-hydroxyaniline; 4-amino-3-chloro-phenol; 4-Amino-3-chlorophenol; 3-chloro-p-aminophenol; 3-Chloro-4-aminophenol; 4-Amino-3-chlor-phenol; Phenol,4-amino-3-chloro; MFCD00801116
Molecular FormulaC6H6ClNO
Molecular Weight143.57
Purity98.00%
Density1.4±0.1 g/cm3
Boiling Point287.3±25.0 °C at 760 mmHg
Melting Point159.5°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17609-80-2 |
| Catalog No. | 2A-9037555 |
| Chinese Name | 4-氨基-3-氯苯酚 |
| Synonyms | EINECS 241-583-3; 2-chloro-4-hydroxyaniline; 4-amino-3-chloro-phenol; 4-Amino-3-chlorophenol; 3-chloro-p-aminophenol; 3-Chloro-4-aminophenol; 4-Amino-3-chlor-phenol; Phenol,4-amino-3-chloro; MFCD00801116 |
| Molecular Formula | C6H6ClNO |
| Molecular Weight | 143.57 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 287.3±25.0 °C at 760 mmHg |
| Melting Point | 159.5°C |
| Storage Condition | 2-8°C |
| HTC | 2922299090 |
| PubChem ID | 7490468 |
| SMILES | Nc1ccc(O)cc1Cl |
| InChI | InChI=1S/C6H6ClNO/c7-5-3-4(9)1-2-6(5)8/h1-3,9H,8H2 |
| InChI Key | PNLPXABQLXSICH-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Barium bis(2,2,6,6-tetramethyl-3,5-heptanedionate) hydrate | 17594-47-7 | 2A-9037545 |
| Deslanoside | 17598-65-1 | 2A-9037547 |
| 2-Amino-3-bromo-5-nitrobenzonitrile | 17601-94-4 | 2A-9037548 |
| Sodium 3-phosphoglycerate | 17603-42-8 | 2A-9037549 |
| D-Phenylglycine ethyl ester hydrochloride | 17609-48-2 | 2A-9037553 |
| 6-Bromophenanthridine | 17613-40-0 | 2A-9037557 |
| 4-(1H-Imidazol-1-yl)benzoic acid | 17616-04-5 | 2A-9037558 |
| 7-Chloro-5-(2-fluorophenyl)-1,3-dihydro-3-hydroxy-2H-1,4-benzodiazepin-2-one | 17617-60-6 | 2A-9037559 |
| Methyl propyl trisulfide | 17619-36-2 | 2A-9037560 |
| Sodium 3-sulfobenzoate | 17625-03-5 | 2A-9037561 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA