
CAS Number17450-34-9
SynonymsEthyl 1H-imidazol-1-ylacetate; Ethyl 2-(1H-imidazol-1-yl)acetate; Ethyl 1H-imidazole-1-acetate
Molecular FormulaC7H10O2N2
Molecular Weight154.17
Purity98.00%
Density1.14g/cm3
Boiling Point293ºC at 760 mmHg
AppearanceColorless to yellow liquid or semi-solid or solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17450-34-9 |
| Catalog No. | 2A-9037493 |
| Chinese Name | 1H-咪唑-1-乙酸乙酯 |
| Synonyms | Ethyl 1H-imidazol-1-ylacetate; Ethyl 2-(1H-imidazol-1-yl)acetate; Ethyl 1H-imidazole-1-acetate |
| Molecular Formula | C7H10O2N2 |
| Molecular Weight | 154.17 |
| Purity | 98.00 |
| Density | 1.14g/cm3 |
| Boiling Point | 293ºC at 760 mmHg |
| Appearance | Colorless to yellow liquid or semi-solid or solid |
| Storage Condition | room temperature, dry |
| HTC | 2933290090 |
| PubChem ID | 5412500 |
| MDL Number | MFCD05149485 |
| SMILES | CCOC(=O)Cn1ccnc1 |
| InChI | InChI=1S/C7H10N2O2/c1-2-11-7(10)5-9-4-3-8-6-9/h3-4,6H,2,5H2,1H3 |
| InChI Key | OITZNDMCFHYWLX-UHFFFAOYSA-N |
| MSDS | msds/37493_1_17450_34_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Amino-4-methylpyrimidine-5-carbonitrile | 17321-97-0 | 2A-9037445 |
| Methyl 4-imidazolecarboxylate | 17325-26-7 | 2A-9037446 |
| 6-Bromobenzo[b]thiophene | 17347-32-9 | 2A-9037457 |
| 5-Cyanoindole-3-carboxaldehyde | 17380-18-6 | 2A-9037471 |
| 3-Piperidin-4-yl-1H-indole | 17403-09-7 | 2A-9037478 |
| 2-Chloro-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carbaldehyde | 17481-62-8 | 2A-9037508 |
| 3-(Bromomethyl)-7-chloro benzo[b]thiophene | 17512-61-7 | 2A-9037514 |
| 5-Fluoro-3-methylbenzo[b]thiophene | 17514-63-5 | 2A-9037516 |
| 7-Chloro-3-methyl benzo[b]thiophene | 17514-68-0 | 2A-9037517 |
| 2-Methyl-5-(trifluoromethyl)furan | 17515-75-2 | 2A-9037518 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA