
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17352-25-9 |
| Catalog No. | 2A-9037462 |
| Chinese Name | 3,5-二碘苯甲醛 |
| Synonyms | Benzaldehyde,3,5-diiodo; 3,5-diidobenzaldehyde; 3,5-bis(iodanyl)benzaldehyde |
| Molecular Formula | C7H4I2O |
| Molecular Weight | 357.92 |
| Purity | 98.00 |
| Density | 2.464g/cm3 |
| Boiling Point | 357.801ºC at 760 mmHg |
| Storage Condition | 2-8℃, dry, sealed |
| HTC | 2913000090 |
| PubChem ID | 15238980 |
| SMILES | O=Cc1cc(I)cc(I)c1 |
| InChI | InChI=1S/C7H4I2O/c8-6-1-5(4-10)2-7(9)3-6/h1-4H |
| InChI Key | WBPOINHGBSDFDZ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,3-Dichloro-4-hydroxybenzaldehyde | 16861-22-6 | 2A-9037268 |
| Phenyl tribromomethyl sulfone | 17025-47-7 | 2A-9037345 |
| Ethyl 4-oxocyclohexanecarboxylate | 17159-79-4 | 2A-9037387 |
| (1alpha)-17-(Acetyloxy)-6-chloro-1-(chloromethyl)pregna-4,6-diene-3,20-dione | 17183-98-1 | 2A-9037395 |
| Cbz-1-amino-1-cyclopentanecarboxylic acid | 17191-44-5 | 2A-9037397 |
| 4-Hydroxycyclohexanecarboxylic acid | 17419-81-7 | 2A-9037484 |
| N-(Chloromethyl)phthalimide | 17564-64-6 | 2A-9037534 |
| 3,5-Bis(tert-butyl)benzaldehyde | 17610-00-3 | 2A-9037556 |
| Propylboronic acid | 17745-45-8 | 2A-9037612 |
| 2-[3-(Trifluoromethyl)benzoyl]aminoacetic acid | 17794-48-8 | 2A-9037633 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA