
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17274-17-8 |
| Catalog No. | 2A-9037430 |
| Chinese Name | 3,5-二碘水杨酸钾 |
| Synonyms | PotassiuM 3,5-Diiodosalicylate; POTASSIUM 3,5-DIIODOSALICYLATE; Diiodosalicylicacidpotassiumsalt |
| Molecular Formula | C7H3I2KO3 |
| Molecular Weight | 395.85 |
| Purity | 98.00 |
| Density | 2.697g/cm3 |
| Boiling Point | 380.8ºC at 760mmHg |
| EINECS | 211-496-5 |
| HTC | 2918290000 |
| PubChem ID | 329798772 |
| MDL Number | MFCD00002443 |
| SMILES | [Li+].Oc1c(I)cc(I)cc1C([O-])=O |
| InChI | 1S/C7H4I2O3.Li/c8-3-1-4(7(11)12)6(10)5(9)2-3;/h1-2,10H,(H,11,12);/q;+1/p-1 |
| InChI Key | HLBRJWWTLIAOTE-UHFFFAOYSA-M |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/37430_1_17274_17_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Dichlorothiophenol | 17231-94-6 | 2A-9037416 |
| Morpholin-4-carboximidamide | 17238-66-3 | 2A-9037418 |
| 3-Chlorobenzenesulfonamide | 17260-71-8 | 2A-9037426 |
| 2-(Diphenylphosphino)benzoic acid | 17261-28-8 | 2A-9037427 |
| 4-Biphenylol diphenyl phosphate | 17269-99-7 | 2A-9037428 |
| Methyl (phenylthio)acetate | 17277-58-6 | 2A-9037431 |
| Ethyl 2-amino-2-methylpropanoate hydrochloride | 17288-15-2 | 2A-0201790 |
| Ethyl 3,5-dichloro-4-hydroxybenzoate | 17302-82-8 | 2A-9037438 |
| O,O-Dimethyl phosphoramidothioate | 17321-47-0 | 2A-9037442 |
| (1-Isocyanoethyl)benzene | 17329-20-3 | 2A-9037447 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA