CAS Number17057-04-4
Synonyms4-(N-Maleimido)benzoic acid; MFCD00458571; 4-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-benzoic acid; EINECS 241-117-9; 4-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)benzoic acid; 4-Maleimidobenzoic acid
Molecular FormulaC11H7NO4
Molecular Weight217.18
Purity98.00%
Density1.5±0.1 g/cm3
Boiling Point447.1±28.0 °C at 760 mmHg
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17057-04-4 |
| Catalog No. | 2A-9037351 |
| Chinese Name | 4-(2,5-二氧代-2,5-二氢-1H-吡咯-1-基)苯甲酸 |
| Synonyms | 4-(N-Maleimido)benzoic acid; MFCD00458571; 4-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-benzoic acid; EINECS 241-117-9; 4-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)benzoic acid; 4-Maleimidobenzoic acid |
| Molecular Formula | C11H7NO4 |
| Molecular Weight | 217.18 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 447.1±28.0 °C at 760 mmHg |
| Appearance | solid |
| Storage Condition | -20°C, store in inert gas |
| Application | 4-Maleimidobenzoic acid is a protein cross-linker. 4-Maleimidobenzoic acid can be used to synthesize maleimide benzoyl spacers. |
| HTC | 2925190090 |
| PubChem ID | 329786681 |
| MDL Number | MFCD00458571 |
| SMILES | OC(=O)c1ccc(cc1)N2C(=O)C=CC2=O |
| InChI | 1S/C11H7NO4/c13-9-5-6-10(14)12(9)8-3-1-7(2-4-8)11(15)16/h1-6H,(H,15,16) |
| InChI Key | LKUOJDGRNKVVFF-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/37351_1_17057_04_4.pdf |
| Use of | 4-Maleimidobenzoic acid is a protein crosslinker. 4-Maleimidobenzoic acid can be used to synthesis maleimidobenzoyl spacers[1]. Properties Biological Activity Chemical & Physical Properties Safety Info Synthetic Route Precursor & Downstream |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl thiooxamate | 16982-21-1 | 2A-9037338 |
| m-Carborane | 16986-24-6 | 2A-9037340 |
| Disodium fumarate | 17013-01-3 | 2A-9037342 |
| Secretin | 17034-35-4 | 2A-9037347 |
| 2-Isocyanatopentanedioic acid diethyl ester | 17046-23-0 | 2A-9037349 |
| 4-(Dimethylamino)phenylacetic acid | 17078-28-3 | 2A-9037355 |
| 4-Ethyl-4'-iodobiphenyl | 17078-76-1 | 2A-9037356 |
| 1,3-Dimethoxypropane | 17081-21-9 | 2A-9037357 |
| Methyltris(dimethylsiloxy)silane | 17082-46-1 | 2A-9037358 |
| Cyasterone | 17086-76-9 | 2A-9037361 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS