CAS Number102-51-2
SynonymsMFCD00047837; 3,4-Diamino anisole; 4-methoxy-1,2-diamino-benzene; 4-Methoxy-1,2-benzenediamine; 4-methoxybenzene-1,2-diamine; 4-Methoxy-1,2-diaminobenzene; 3,4-Diaminoanisole
Molecular FormulaC7H10O1N2
Molecular Weight138.17
Purity98%
Density1.2±0.1 g/cm3
Boiling Point302.4±22.0 °C at 760 mmHg
Melting Point46-48°C
AppearanceDark brown black solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 102-51-2 |
| Catalog No. | 2A-9003729 |
| Chinese Name | 4-甲氧基邻苯二胺 |
| Synonyms | MFCD00047837; 3,4-Diamino anisole; 4-methoxy-1,2-diamino-benzene; 4-Methoxy-1,2-benzenediamine; 4-methoxybenzene-1,2-diamine; 4-Methoxy-1,2-diaminobenzene; 3,4-Diaminoanisole |
| Molecular Formula | C7H10O1N2 |
| Molecular Weight | 138.17 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 302.4±22.0 °C at 760 mmHg |
| Melting Point | 46-48°C |
| Appearance | Dark brown black solid |
| Storage Condition | Store in a cool, ventilated warehouse. Keep away f |
| HTC | 2922299090 |
| MDL Number | MFCD00047837 |
| SMILES | COc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C7H10N2O/c1-10-5-2-3-6(8)7(9)4-5/h2-4H,8-9H2,1H3 |
| InChI Key | AGAHETWGCFCMDK-UHFFFAOYSA-N |
| MSDS | msds/3729_1_102_51_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,4,5-Trihydroxybenzoic acid stearyl ester | 10361-12-3 | 2A-9003721 |
| 3,4,5-Trimethoxycinnamic acid | 90-50-6 | 2A-9003722 |
| 3,4,5-Trimethoxyphenylacetonitrile | 13338-63-1 | 2A-9003723 |
| Tri-O-acetyl-D-glucal | 2873-29-2 | 2A-9003726 |
| 3,4-Bis(1-methylhydrazino)cyclobut-3-ene-1,2-dione | 50376-99-3 | 2A-9003727 |
| 3,4-Diaminobenzonitrile | 17626-40-3 | 2A-9003730 |
| 3,4-Diaminobenzotrifluoride | 368-71-8 | 2A-9003731 |
| 3,4-Dichloro-5-nitro-2-methylbenzotrifluoride | 115571-68-1 | 2A-9003738 |
| 3,4-Dichlorobenzenesulphonyl chloride | 98-31-7 | 2A-9003740 |
| 3,4-Dichlorobenzonitrile | 6574-99-8 | 2A-9003742 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS