
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16837-52-8 |
| Catalog No. | 2A-9037258 |
| Chinese Name | 氧化苦参碱; 苦参素 |
| Synonyms | Ammothamnine; Matrine N-oxide; Oxymatrine |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.363 |
| Purity | 98.00 |
| Appearance | white to off-white |
| Water Solubility | methanol: soluble10mg/mL, clear, colorless |
| Storage Condition | Warehouse is low temperature, ventilated and dry |
| Application | Oxymatrine is an alkaloid derived from the roots of Sophora species and has anti-inflammatory, anti-fibrotic and anti-tumor effects. Can inhibit iNOS expression and TGF-β/Smad pathway. |
| PubChem ID | 50096750 |
| SMILES | O=C1CCCC2C3CCC[N+]4([O-])CCCC(CN12)C34 |
| InChI | InChI=1S/C15H24N2O2/c18-14-7-1-6-13-12-5-3-9-17(19)8-2-4-11(15(12)17)10-16(13)14/h11-13,15H,1-10H2/t11-,12+,13+,15-,17?/m0/s1 |
| InChI Key | XVPBINOPNYFXID-LHDUFFHYSA-N |
| MSDS | msds/37258_1_16837_52_8.pdf |
| Transport Info | Product Name: Oxymatrine |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Amino-N-cyclohexylacetamide | 16817-90-6 | 2A-9037251 |
| 5-Ethyl-5-methylhydantoin | 16820-12-5 | 2A-9037252 |
| 2-Methyl-L-serine | 16820-18-1 | 2A-9037253 |
| Aluminium sulfate hexadecahydrate | 16828-11-8 | 2A-9037254 |
| 1-Benzyl-L-histidine | 16832-24-9 | 2A-9037256 |
| Epifriedelanol | 16844-71-6 | 2A-9037260 |
| Ethyl 2-cyano-3-(dimethylamino)acrylate | 16849-87-9 | 2A-9037261 |
| Zirconium tungstate | 16853-74-0 | 2A-9037262 |
| Tris(2-pyridylmethyl)amine | 16858-01-8 | 2A-9037267 |
| o-Carborane | 16872-09-6 | 2A-9037275 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA