
CAS Number20017-67-8
Synonyms3,3-diphenylpropanol; 1-Propanol,3,3-diphenyl; diphenylpropan-1-ol; EINECS 243-466-2; MFCD00002930; 3,3-Diphenylpropan-1-ol; 3,3-Diphenyl-1-propanol; 3,3-diphenylpropyl alcohol; 3,3-diphenyl-propan-1-ol
Molecular FormulaC15H16O1
Molecular Weight212.29
Purity97%
Density1.1±0.1 g/cm3
Boiling Point325.5±0.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 20017-67-8 |
| Catalog No. | 2A-9003703 |
| Chinese Name | 3,3-二苯基-1-丙醇 |
| Synonyms | 3,3-diphenylpropanol; 1-Propanol,3,3-diphenyl; diphenylpropan-1-ol; EINECS 243-466-2; MFCD00002930; 3,3-Diphenylpropan-1-ol; 3,3-Diphenyl-1-propanol; 3,3-diphenylpropyl alcohol; 3,3-diphenyl-propan-1-ol |
| Molecular Formula | C15H16O1 |
| Molecular Weight | 212.29 |
| Purity | 97 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 325.5±0.0 °C at 760 mmHg |
| Storage Condition | Woven bag lined with polyethylene plastic bag pack |
| HTC | 2906.29.6000 |
| MDL Number | MFCD00002930 |
| SMILES | OCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H16O/c16-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |
| InChI Key | IDCXQMVSIIJUEH-UHFFFAOYSA-N |
| MSDS | msds/3703_1_20017_67_8.pdf |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,3'-Dihydroxydiphenyldisulphide | 21101-56-4 | 2A-9003697 |
| 3,3-Dimethyl-1-butyne | 917-92-0 | 2A-0201541 |
| 3,3-Dimethyl-1-pyridin-2-ylbutan-2-one | 34552-04-0 | 2A-9003700 |
| 3,3-Dimethylbutanoyl chloride | 7065-46-5 | 2A-9003701 |
| 3,3-Dimethylbutyric acid | 1070-83-3 | 2A-9003702 |
| 3,3-Diphenylpropionic acid | 606-83-7 | 2A-9003704 |
| 3,3-Diphenylpropionitrile | 2286-54-6 | 2A-9003705 |
| 3,3-Pentamethylene glutarimide | 1130-32-1 | 2A-9003706 |
| 3,3-Pentamethylene-2-pyrrolidinone | 1005-85-2 | 2A-9003707 |
| 3,4,5,6-Tetrachlorophthalimide | 1571-13-7 | 2A-9003708 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA