
CAS Number1547-36-0
Synonyms4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butanoic acid; MFCD00040910; 4,4,4-Trifluoro-3-hydroxy-3-(trifluoromethyl)butyric acid
Molecular FormulaC5H4F6O3
Molecular Weight226.07400
Purity97%
Density1.661 g/cm3
Boiling Point255.8ºC at 760 mmHg
Melting Point85°C
Appearancewhite solid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1547-36-0 |
| Catalog No. | 2A-9003687 |
| Chinese Name | 4,4,4-三氟-3-羟基-3-(三氟甲基)丁酸 |
| Synonyms | 4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butanoic acid; MFCD00040910; 4,4,4-Trifluoro-3-hydroxy-3-(trifluoromethyl)butyric acid |
| Molecular Formula | C5H4F6O3 |
| Molecular Weight | 226.07400 |
| Purity | 97 |
| Density | 1.661 g/cm3 |
| Boiling Point | 255.8ºC at 760 mmHg |
| Melting Point | 85°C |
| Appearance | white solid |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| Packaging | II |
| HTC | 2918199090 |
| SMILES | OC(=O)CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H4F6O3/c6-4(7,8)3(14,1-2(12)13)5(9,10)11/h14H,1H2,(H,12,13) |
| InChI Key | InChIKey=NOHJBOWARMTILE-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/3687_1_1547_36_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-(Trifluoromethyl)phenylacetic acid | 351-35-9 | 2A-9003677 |
| 3-(Trifluoromethyl)phenylboronic acid | 1423-26-3 | 2A-9003678 |
| 3-(Trifluoromethyl)propiophenone | 1533-03-5 | 2A-9003679 |
| 3,3',5,5'-Tetrakis(trifluoromethyl)benzophenone | 175136-66-0 | 2A-9003685 |
| 3,3-Bis(methylthio)-2-[3-(trifluoromethyl)benzoyl]acrylonitrile | 116492-97-8 | 2A-9003686 |
| 3,3'-Bis(trifluoromethyl)diphenylmethane | 86845-35-4 | 2A-9003688 |
| 3,4,5-Trifluorobenzaldehyde | 132123-54-7 | 2A-9003714 |
| 3,4,5-Trifluorophenylboronic acid | 143418-49-9 | 2A-9003720 |
| 3,4,5-Trimethoxyphenylboronic acid | 182163-96-8 | 2A-9003724 |
| 3,4'-Bis(trifluoromethyl)benzophenone | 21084-22-0 | 2A-9003728 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA