CAS Number16218-32-9
Synonyms2,7-Diiodophenanthrenequinone; 2,7-diiodo-9,10-phenanthrenequinone; 2,7-diodophenanthrenequinone; 2,7-diiodo-phenanthrene-9,10-dione; 2,7-diiodophenanthrene-9,10-quinone; 2,7-Diiodo-9,10-phenanthrenedione; 2,7-diiodophenanthren-9,10-dione; 2,7-diiodo-9,10-phenenthrenequinone; ZLD0612
Molecular FormulaC14H6I2O2
Molecular Weight460.01
Purity98.00%
Density2.3±0.1 g/cm3
Boiling Point547.1±43.0 °C at 760 mmHg
Melting Point309-310ºC
Appearancered solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16218-32-9 |
| Catalog No. | 2A-9036834 |
| Chinese Name | 2,7-二碘菲醌 |
| Synonyms | 2,7-Diiodophenanthrenequinone; 2,7-diiodo-9,10-phenanthrenequinone; 2,7-diodophenanthrenequinone; 2,7-diiodo-phenanthrene-9,10-dione; 2,7-diiodophenanthrene-9,10-quinone; 2,7-Diiodo-9,10-phenanthrenedione; 2,7-diiodophenanthren-9,10-dione; 2,7-diiodo-9,10-phenenthrenequinone; ZLD0612 |
| Molecular Formula | C14H6I2O2 |
| Molecular Weight | 460.01 |
| Purity | 98.00 |
| Density | 2.3±0.1 g/cm3 |
| Boiling Point | 547.1±43.0 °C at 760 mmHg |
| Melting Point | 309-310ºC |
| Appearance | red solid |
| Storage Condition | Room temperature, dry, protected from light |
| HTC | 2914700090 |
| PubChem ID | 3946474 |
| SMILES | O=C1C(=O)c2cc(I)ccc2-c2ccc(I)cc21 |
| InChI | InChI=1S/C14H6I2O2/c15-7-1-3-9-10-4-2-8(16)6-12(10)14(18)13(17)11(9)5-7/h1-6H |
| InChI Key | FJEXTLBWOUQIBN-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Plastic & Specialty Additives | ||
|---|---|---|
| 3-Methyl-4-iodopyrazole | 15802-75-2 | 2A-9036661 |
| Benzyltriphenylphosphonium iodide | 15853-35-7 | 2A-9036676 |
| Triphenylpropylphosphonium bromide | 15912-75-1 | 2A-9036711 |
| Allylidenetriphenylphosphorane | 15935-94-1 | 2A-9036718 |
| cis-Diamminediiodoplatinum | 15978-93-5 | 2A-9036732 |
| Bis-(triphenylphosphino)-cuprous borohydride | 16903-61-0 | 2A-9037294 |
| Carbonylchlorohydrotris(triphenylphosphine)ruthenium | 16971-33-8 | 2A-9037336 |
| Carbonyltris(triphenylphosphine)rhodium(I) hydride | 17185-29-4 | 2A-9037396 |
| Tripotassium hydrogen ethylenediaminetetraacetate | 17572-97-3 | 2A-9037536 |
| 3-Carboxypropyltriphenylphosphonium bromide | 17857-14-6 | 2A-9037655 |
| Browse all Plastic & Specialty Additives products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS