
CAS Number16079-88-2
SynonymsMFCD00037350; N-Bromo-N'-chloro-5,5-dimethylhydantoin; 1-Bromo-3-chloro-5,5-dimethylimidazolidine-2,4-dione; T5NVNV EHJ AE CG E1 E1; 1-Bromo-3-chloro-5,5-dimethylhydantoin; 1-Bromo-3-chloro-5,5-dimethyl-2,4-imidazolidinedione; EINECS 240-230-0
Molecular FormulaC5H6BrClN2O2
Molecular Weight241.470
Purity98.00%
Density1.9±0.1 g/cm3
Boiling Point232.7±23.0 °C at 760 mmHg
Melting Point159 - 163ºC (Decomposes)
AppearanceWhite to off-white solid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16079-88-2 |
| Catalog No. | 2A-9036776 |
| Chinese Name | 1-溴-3-氯-5,5-二甲基海因 |
| Synonyms | MFCD00037350; N-Bromo-N'-chloro-5,5-dimethylhydantoin; 1-Bromo-3-chloro-5,5-dimethylimidazolidine-2,4-dione; T5NVNV EHJ AE CG E1 E1; 1-Bromo-3-chloro-5,5-dimethylhydantoin; 1-Bromo-3-chloro-5,5-dimethyl-2,4-imidazolidinedione; EINECS 240-230-0 |
| Molecular Formula | C5H6BrClN2O2 |
| Molecular Weight | 241.470 |
| Purity | 98.00 |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 232.7±23.0 °C at 760 mmHg |
| Melting Point | 159 - 163ºC (Decomposes) |
| Appearance | White to off-white solid |
| Storage Condition | 2-8°C |
| Packaging | II |
| HTC | 2933290090 |
| PubChem ID | 3161457 |
| SMILES | CC1(C)C(=O)N(Cl)C(=O)N1Br |
| InChI | InChI=1S/C5H6BrClN2O2/c1-5(2)3(10)8(7)4(11)9(5)6/h1-2H3 |
| InChI Key | PIEXCQIOSMOEOU-UHFFFAOYSA-N |
| Hazard Symbols | 5.1 |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Guanidinobenzoic acid | 16060-65-4 | 2A-9036763 |
| 6-Iodoquinazolin-4-one | 16064-08-7 | 2A-9036766 |
| 3,4-Dihydro-6-hydroxyquinazolin-4-one | 16064-10-1 | 2A-9036767 |
| 1,2-Bis(triethoxysilyl)ethane | 16068-37-4 | 2A-9036770 |
| Dicyclohexano-18-crown-6 | 16069-36-6 | 2A-9036771 |
| 3-(Perfluoro-5-methylhexyl)-2-hydroxypropyl methacrylate | 16083-81-1 | 2A-9036780 |
| 3-Methyl-4-(pyrrolidin-1-yl)aniline | 16089-43-3 | 2A-9036782 |
| Potassium cinnamate | 16089-48-8 | 2A-9036783 |
| Dibutyl suberate | 16090-77-0 | 2A-9036786 |
| Dioctyl(maleate)tin | 16091-18-2 | 2A-9036787 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA