
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 15931-15-4 |
| Catalog No. | 2A-9036715 |
| Chinese Name | 2-甲基-3-氟吡啶 |
| Synonyms | 3-Fluor-2-methylpyridin; 3-Fluoro-2-methylpyridine |
| Molecular Formula | C6H6FN |
| Molecular Weight | 111.12 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 113.9±20.0 °C at 760 mmHg |
| Appearance | Liquid | Colorless to pale yellow |
| Water Solubility | Slightly soluble in water. |
| Storage Condition | room temperature, dry |
| HTC | 2933399090 |
| PubChem ID | 36589653 |
| SMILES | Cc1ncccc1F |
| InChI | InChI=1S/C6H6FN/c1-5-6(7)3-2-4-8-5/h2-4H,1H3 |
| InChI Key | IRIHSZDBTACXCT-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2,5-Dibromo-3-nitropyridine | 15862-37-0 | 2A-9036688 |
| 3-Bromo-2-methoxy-5-nitropyridine | 15862-50-7 | 2A-9036689 |
| 1,3,5-Tris[3-(dimethylamino)propyl]hexahydro-1,3,5-triazine | 15875-13-5 | 2A-9036695 |
| 4-Chloropyrazole | 15878-00-9 | 2A-9036697 |
| Ethyl 4-acetyl-5-methylisoxazole-3-carboxylate | 15911-11-2 | 2A-9036709 |
| 5-Chloro-3-methylpyrazole | 15953-45-4 | 2A-9036720 |
| 4,5-Dichloroimidazole | 15965-30-7 | 2A-9036727 |
| 4-Chloroimidazole | 15965-31-8 | 2A-9036728 |
| 2-Chloro-5-methoxybenzimidazole | 15965-54-5 | 2A-9036729 |
| 1-(3-Methoxyphenyl)piperazine | 16015-71-7 | 2A-9036743 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA