
CAS Number351-36-0
Synonymsm-Trifluoromethyl acetanilide; N-acetyl-3-trifluoromethylbenzenamine; USAF MA-14; 3-Trifluoromethylacetanilide; 3-Acetamidobenzotrifluoride; m-Acetaminobenzotrifluoride; EINECS 206-512-2; MFCD00000383
Molecular FormulaC9H8F3NO
Molecular Weight203.16100
Purity98%
Density1.302g/cm3
Boiling Point292ºC at 760mmHg
Melting Point103-106ºC
AppearanceWhite to off-white crystal or crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 351-36-0 |
| Catalog No. | 2A-9003671 |
| Chinese Name | 3-乙酰氨基三氟甲苯 |
| Synonyms | m-Trifluoromethyl acetanilide; N-acetyl-3-trifluoromethylbenzenamine; USAF MA-14; 3-Trifluoromethylacetanilide; 3-Acetamidobenzotrifluoride; m-Acetaminobenzotrifluoride; EINECS 206-512-2; MFCD00000383 |
| Molecular Formula | C9H8F3NO |
| Molecular Weight | 203.16100 |
| Purity | 98 |
| Density | 1.302g/cm3 |
| Boiling Point | 292ºC at 760mmHg |
| Melting Point | 103-106ºC |
| Appearance | White to off-white crystal or crystalline powder |
| Storage Condition | Room temperature. |
| HTC | 2924299090 |
| SMILES | CC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H8F3NO/c1-6(14)13-8-4-2-3-7(5-8)9(10,11)12/h2-5H,1H3,(H,13,14) |
| InChI Key | HNIPNANLYHXYDE-UHFFFAOYSA-N |
| MSDS | msds/3671_1_351_36_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-(Hydroxymethyl)phenylboronic acid | 87199-15-3 | 2A-9003649 |
| 3-(Meththio)phenylboronic acid | 128312-11-8 | 2A-9003650 |
| 3-(N,N-Dimethylaminocarbonyl)benzene boronic acid | 373384-14-6 | 2A-9003652 |
| 3-(Trifluoromethoxy)benzaldehyde | 52771-21-8 | 2A-9003661 |
| 3-(Trifluoromethoxy)phenylboronic acid | 179113-90-7 | 2A-9003670 |
| 3'-(Trifluoromethyl)acetophenone | 349-76-8 | 2A-9003672 |
| 3-(Trifluoromethyl)benzoic acid | 454-92-2 | 2A-9003673 |
| 3-(Trifluoromethyl)benzoyl chloride | 2251-65-2 | 2A-9003674 |
| 3-(Trifluoromethyl)benzyl chloride | 705-29-3 | 2A-9003675 |
| 3-(Trifluoromethyl)cinnamic acid | 779-89-5 | 2A-9003676 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA