
CAS Number15893-42-2
SynonymsMFCD02258671; 4-methoxy-chloropropiophenone; 3-(4-methoxy-phenyl)-propionyl chloride; 3-(4-methoxyphenyl)propionic acid chloride; 3-(4'-methoxyphenyl)propanoyl chloride; 3-(4-METHOXYPHENYL)PROPIONYL CHLORIDE
Molecular FormulaC10H11O2Cl1
Molecular Weight198.65
Purity98.00%
Density1.159g/cm3
Boiling Point291ºC at 760mmHg
Melting Point117-119 °C(lit.)
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 15893-42-2 |
| Catalog No. | 2A-9036702 |
| Chinese Name | 3-(4-甲氧基苯基)丙酰氯 |
| Synonyms | MFCD02258671; 4-methoxy-chloropropiophenone; 3-(4-methoxy-phenyl)-propionyl chloride; 3-(4-methoxyphenyl)propionic acid chloride; 3-(4'-methoxyphenyl)propanoyl chloride; 3-(4-METHOXYPHENYL)PROPIONYL CHLORIDE |
| Molecular Formula | C10H11O2Cl1 |
| Molecular Weight | 198.65 |
| Purity | 98.00 |
| Density | 1.159g/cm3 |
| Boiling Point | 291ºC at 760mmHg |
| Melting Point | 117-119 °C(lit.) |
| Storage Condition | Sealed at room temperature, protected from light, |
| Packaging | II |
| HTC | 2918990090 |
| PubChem ID | 15984181 |
| MDL Number | MFCD02258671 |
| SMILES | COc1ccc(CCC(=O)Cl)cc1 |
| InChI | InChI=1S/C10H11ClO2/c1-13-9-5-2-8(3-6-9)4-7-10(11)12/h2-3,5-6H,4,7H2,1H3 |
| InChI Key | FQVJPHCAWYRYCK-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/36702_1_15893_42_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Cyclohexyl-5-chlorovaleramide | 15865-18-6 | 2A-9036692 |
| 6-Methoxynicotinonitrile | 15871-85-9 | 2A-9036693 |
| Ponceau 4R Lake | 15876-47-8 | 2A-9036696 |
| alpha-Chloralose | 15879-93-3 | 2A-9036700 |
| 2',6'-Pipecoloxylidide | 15883-20-2 | 2A-9036701 |
| Sodium 4-acetamidobenzenesulfinate | 15898-43-8 | 2A-9036706 |
| Methyl nicotinate 1-oxide | 15905-18-7 | 2A-9036708 |
| 6-Fluoro-2-methylquinolin-4-ol | 15912-68-2 | 2A-9036710 |
| 3-(N-Methylamino)-L-alanine | 15920-93-1 | 2A-9036713 |
| N-Benzoyl-4-perhydroazepinone | 15923-40-7 | 2A-9036714 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA