CAS Number203302-97-0
Synonyms[3-(Trifluoromethoxy)phenyl]acetic acid; QV1R COXFFF; 3-(Trifluoromethoxy)phenylacetic Acid; 2-[3-(Trifluoromethoxy)phenyl]acetic acid; MFCD00082480; 3-Trifluoromethoxyphenylacetic acid; 3-(Trifluoromethoxy)benzeneacetic acid
Molecular FormulaC9H7O3F3
Molecular Weight220.15
Purity98%
Density1.4±0.1 g/cm3
Boiling Point260.2±35.0 °C at 760 mmHg
Melting Point53-55°C
Appearancewhite solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 203302-97-0 |
| Catalog No. | 2A-9003668 |
| Chinese Name | 3-(三氟甲氧基)苯乙酸 |
| Synonyms | [3-(Trifluoromethoxy)phenyl]acetic acid; QV1R COXFFF; 3-(Trifluoromethoxy)phenylacetic Acid; 2-[3-(Trifluoromethoxy)phenyl]acetic acid; MFCD00082480; 3-Trifluoromethoxyphenylacetic acid; 3-(Trifluoromethoxy)benzeneacetic acid |
| Molecular Formula | C9H7O3F3 |
| Molecular Weight | 220.15 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 260.2±35.0 °C at 760 mmHg |
| Melting Point | 53-55°C |
| Appearance | white solid |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| HTC | 2918990090 |
| MDL Number | MFCD00082480 |
| SMILES | O=C(O)Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C9H7F3O3/c10-9(11,12)15-7-3-1-2-6(4-7)5-8(13)14/h1-4H,5H2,(H,13,14) |
| InChI Key | NFZQVADYFXRRPM-UHFFFAOYSA-N |
| MSDS | msds/3668_1_203302_97_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 3-(Trifluoromethoxy)phenylacetic acid Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(Trifluoromethoxy)benzonitrile | 52771-22-9 | 2A-9003663 |
| 3-(Trifluoromethoxy)benzyl bromide | 159689-88-0 | 2A-9003664 |
| 3-(Trifluoromethoxy)chlorobenzene | 772-49-6 | 2A-9003665 |
| 3-(Trifluoromethoxy)fluorobenzene | 1077-01-6 | 2A-9003666 |
| 3-(Trifluoromethoxy)phenol | 827-99-6 | 2A-9003667 |
| 3-(Trifluoromethoxy)phenylacetonitrile | 108307-56-8 | 2A-9003669 |
| 3,3,3-Tris(4-chlorophenyl)propionis acid | 2168-06-1 | 2A-9003681 |
| 3,3,4,4,5,5,6,6-Octafluorooctan-1,8-diol | 83192-87-4 | 2A-9003682 |
| 3,3,4,5,5,5-Hexafluoropentan-2-ol | 2711-81-1 | 2A-9003683 |
| 3,3,4,5,5,5-Hexafluoropentan-2-one | 60249-67-4 | 2A-9003684 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS