
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 15837-41-9 |
| Catalog No. | 2A-9036671 |
| Chinese Name | 5-羟基嘧啶-4(3H)-酮 |
| Synonyms | 5-Hydroxy-4(1H)-pyrimidinone; 5-Hydroxypyrimidin-4(1H)-one; 5-hydroxy-1H-pyrimidin-6-one; 5-Hydroxy-1,4-dihydropyrimidin-4-one |
| Molecular Formula | C4H4O2N2 |
| Molecular Weight | 112.09 |
| Purity | 98.00 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 243.6±50.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2933599090 |
| PubChem ID | 6891537 |
| MDL Number | MFCD18373954 |
| SMILES | O=c1[nH]cncc1O |
| InChI | InChI=1S/C4H4N2O2/c7-3-1-5-2-6-4(3)8/h1-2,7H,(H,5,6,8) |
| InChI Key | URCOLWAKIPNTEM-UHFFFAOYSA-N |
| MSDS | msds/36671_1_15837_41_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,3,6,6-Tetramethoxy-1,4-cyclohexadiene | 15791-03-4 | 2A-9036654 |
| 4,6-Diaminoresorcinol | 15791-87-4 | 2A-9036656 |
| 3-Dimethylaminoanisole | 15799-79-8 | 2A-9036659 |
| Sodium cromoglycate | 15826-37-6 | 2A-9036668 |
| Diethylenetriaminepenta(methylene-phosphonic acid) | 15827-60-8 | 2A-9036669 |
| Ethyl phosphite | 15845-66-6 | 2A-9036672 |
| 5-Bromopentyl acetate | 15848-22-3 | 2A-9036674 |
| 2-Phenyl-4-nitroanisol | 15854-75-8 | 2A-9036677 |
| 2-Chloro-6-methoxyisonicotinic acid | 15855-06-8 | 2A-9036679 |
| Ethyl pipecolinate | 15862-72-3 | 2A-9036690 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA