
CAS Number15686-33-6
Synonyms2,2'-Methylen-bis-<4-chlor-3-methyl-6-isopropyl-phenol>; Biclotymolum [INN-Latin]; 2,2'-methylenebis(4-chloro-3-methyl-6-isopropylphenol); 2,2'-methylenebis(4-chloro-6-isopropyl-3-methylphenol); Hexaspray (TN); Biclotymol; 4,4'-Dichlor-6,6'-diisopropyl-3,3'-dimethyl-2,2'-methandiyl-di-phenol; Biclotymolum; Biclotymol (INN); UNII-W4K0AE8XW9; 6,6'-Dichlor-2,2'-methylendithymol; 4,4'-dichloro-6,6'-diisopropyl-3,3'-dimethyl-2,2'-methanediyl-di-phenol
Molecular FormulaC21H26O2Cl2
Molecular Weight381.34
Purity98.00%
Density1.183g/cm3
Boiling Point479ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 15686-33-6 |
| Catalog No. | 2A-9036621 |
| Chinese Name | 双氯麝酚 |
| Synonyms | 2,2'-Methylen-bis-<4-chlor-3-methyl-6-isopropyl-phenol>; Biclotymolum [INN-Latin]; 2,2'-methylenebis(4-chloro-3-methyl-6-isopropylphenol); 2,2'-methylenebis(4-chloro-6-isopropyl-3-methylphenol); Hexaspray (TN); Biclotymol; 4,4'-Dichlor-6,6'-diisopropyl-3,3'-dimethyl-2,2'-methandiyl-di-phenol; Biclotymolum; Biclotymol (INN); UNII-W4K0AE8XW9; 6,6'-Dichlor-2,2'-methylendithymol; 4,4'-dichloro-6,6'-diisopropyl-3,3'-dimethyl-2,2'-methanediyl-di-phenol |
| Molecular Formula | C21H26O2Cl2 |
| Molecular Weight | 381.34 |
| Purity | 98.00 |
| Density | 1.183g/cm3 |
| Boiling Point | 479ºC at 760mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2908199090 |
| PubChem ID | 805163 |
| MDL Number | MFCD00865128 |
| SMILES | Cc1c(Cl)cc(C(C)C)c(O)c1Cc1c(C)c(Cl)cc(C(C)C)c1O |
| InChI | InChI=1S/C21H26Cl2O2/c1-10(2)14-8-18(22)12(5)16(20(14)24)7-17-13(6)19(23)9-15(11(3)4)21(17)25/h8-11,24-25H,7H2,1-6H3 |
| InChI Key | HNOOXWDWUSLXOB-UHFFFAOYSA-N |
| MSDS | msds/36621_1_15686_33_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 7-Chloro-2-methyl-4-quinolinol | 15644-88-9 | 2A-9036604 |
| 6-Methoxy-2-methyl-4-quinolinol | 15644-90-3 | 2A-9036606 |
| Pheophorbide A | 15664-29-6 | 2A-9036612 |
| Octyl cyanoacetate | 15666-97-4 | 2A-9036613 |
| Sulpiride | 15676-16-1 | 2A-9036615 |
| LOMOFUNGIN | 26786-84-5 | 2A-9036623 |
| Butyl 2-methylbutyrate | 15706-73-7 | 2A-9036626 |
| EDTA ferric sodium salt | 15708-41-5 | 2A-9036630 |
| DIETHYL METHYLPHOSPHONITE | 15715-41-0 | 2A-9036631 |
| 2-Chlorothiobenzamide | 15717-17-6 | 2A-9036632 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA