CAS Number1014-81-9
SynonymsEINECS 213-802-2; m-(Trifluoromethoxy)benzoic acid; QVR COXFFF; 3-(Trifluoromethoxy)benzoicacid; 3-Trifluormethoxy-benzoesaeure; 3-trifluoromethoxy benzoic acid; α,α,α-Trifluoro-m-anisic acid; MFCD00041501; 3-(Trifluoromethoxy)benzoic acid; 3-trifluoromethyloxybenzoic acid
Molecular FormulaCF3OC6H4CO2H
Molecular Weight206.12
Purity97%
Density1.4±0.1 g/cm3
Boiling Point243.8±35.0 °C at 760 mmHg
Melting Point89-92 °C (lit.)
Appearancewhite powder
EINECS213-802-2
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1014-81-9 |
| Catalog No. | 2A-9003662 |
| Chinese Name | 3-(三氟甲氧基)苯甲酸 |
| Synonyms | EINECS 213-802-2; m-(Trifluoromethoxy)benzoic acid; QVR COXFFF; 3-(Trifluoromethoxy)benzoicacid; 3-Trifluormethoxy-benzoesaeure; 3-trifluoromethoxy benzoic acid; α,α,α-Trifluoro-m-anisic acid; MFCD00041501; 3-(Trifluoromethoxy)benzoic acid; 3-trifluoromethyloxybenzoic acid |
| Molecular Formula | CF3OC6H4CO2H |
| Molecular Weight | 206.12 |
| Purity | 97 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 243.8±35.0 °C at 760 mmHg |
| Melting Point | 89-92 °C (lit.) |
| Appearance | white powder |
| Storage Condition | Keep container sealed and stored in a cool, dry pl |
| EINECS | 213-802-2 |
| HTC | 2918990090 |
| PubChem ID | 24858184 |
| MDL Number | MFCD00041501 |
| SMILES | OC(=O)c1cccc(OC(F)(F)F)c1 |
| InChI | 1S/C8H5F3O3/c9-8(10,11)14-6-3-1-2-5(4-6)7(12)13/h1-4H,(H,12,13) |
| InChI Key | OKPFIWIMBJNFSE-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | Xi |
| Risk Codes | R36/37/38 |
| Safety Description | S26;S37/39 |
| MSDS | msds/3662_1_1014_81_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(Octylamino)propionitrile | 29504-89-0 | 2A-9003654 |
| 3-(tert-Butyl)aniline | 5369-19-7 | 2A-9003657 |
| 3-(tert-Octylamino)propionitrile | 86375-28-2 | 2A-9003658 |
| 3-(Trifluoromethoxy)aniline | 1535-73-5 | 2A-9003659 |
| 3-(Trifluoromethoxy)anisole | 142738-94-1 | 2A-9003660 |
| 3-(Trifluoromethoxy)benzonitrile | 52771-22-9 | 2A-9003663 |
| 3-(Trifluoromethoxy)benzyl bromide | 159689-88-0 | 2A-9003664 |
| 3-(Trifluoromethoxy)chlorobenzene | 772-49-6 | 2A-9003665 |
| 3-(Trifluoromethoxy)fluorobenzene | 1077-01-6 | 2A-9003666 |
| 3-(Trifluoromethoxy)phenol | 827-99-6 | 2A-9003667 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS