
CAS Number15485-66-2
Synonyms2,4,6-trihydroxyphenyl-4'-methoxybenzylketone; 2,4,6-trihydroxy-4'-methoxydeoxybenzoin; 2-(4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethan-1-one; 1-(2,4,6-TRIHYDROXYPHENYL)-2-(4-METHOXYPHENYL)ETHANONE
Molecular FormulaC15H14O5
Molecular Weight274.276
Purity98.00%
Density1.364 g/cm3
Boiling Point475.7ºC at 760 mmHg
Melting Point193-197ºC
AppearanceColorless to light yellow crystals
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 15485-66-2 |
| Catalog No. | 2A-9036558 |
| Chinese Name | 2-(4-甲氧基苯基)-1-(2,4,6-三羟基苯基)乙酮 |
| Synonyms | 2,4,6-trihydroxyphenyl-4'-methoxybenzylketone; 2,4,6-trihydroxy-4'-methoxydeoxybenzoin; 2-(4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethan-1-one; 1-(2,4,6-TRIHYDROXYPHENYL)-2-(4-METHOXYPHENYL)ETHANONE |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.276 |
| Purity | 98.00 |
| Density | 1.364 g/cm3 |
| Boiling Point | 475.7ºC at 760 mmHg |
| Melting Point | 193-197ºC |
| Appearance | Colorless to light yellow crystals |
| HTC | 2914509090 |
| PubChem ID | 117415 |
| MDL Number | MFCD00020121 |
| SMILES | COc1ccc(CC(=O)c2c(O)cc(O)cc2O)cc1 |
| InChI | InChI=1S/C15H14O5/c1-20-11-4-2-9(3-5-11)6-12(17)15-13(18)7-10(16)8-14(15)19/h2-5,7-8,16,18-19H,6H2,1H3 |
| InChI Key | KYODHQXYXKDRTF-UHFFFAOYSA-N |
| MSDS | msds/36558_1_15485_66_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(1-Pyridinio)-1-propanesulfonate | 15471-17-7 | 2A-9036553 |
| Phosphonic acid sodium salt | 15475-67-9 | 2A-9036554 |
| 4-(2-Oxopropyl)benzoic acid | 15482-54-9 | 2A-9036555 |
| Sodium 2-chloroethanesulfonate monohydrate | 15484-44-3 | 2A-9036556 |
| Methyl 2-(hydroxymethyl)acrylate | 15484-46-5 | 2A-9036557 |
| 7-Hydroxy-4'-nitroisoflavone | 15485-80-0 | 2A-9036559 |
| 3-(4-Chlorophenyl)-7-hydroxychromen-4-one | 15485-81-1 | 2A-9036560 |
| 3-Bromopropionyl chloride | 15486-96-1 | 2A-9036562 |
| Rhodium triiodide | 15492-38-3 | 2A-9036563 |
| 4,4'-(9-Fluorenylidene)dianiline | 15499-84-0 | 2A-9036564 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA