
CAS Number15351-09-4
SynonymsMetamfepramona [Spanish]; Metamfepramone; Propiophenone,2-(dimethylamino); 2-dimethylamino-1-phenyl-1-propanone; 2-dimethylamino-1-phenyl-propan-1-one; N,N-dimethyl amino-2 propiophenone; (+-)-2-Dimethylamino-1-phenyl-propan-1-on; 1-Propanone,2-(dimethylamino)-1-phenyl; 2-(Dimethylamino)-1-phenyl-1-propanon; 2-(Dimethylamino)propiophenone; Dimepropion; Metamfepramonum [Latin]; Metamfepyramone; MG 559
Molecular FormulaC11H15NO
Molecular Weight177.24300
Purity98.00%
Density0.995g/cm3
Boiling Point256.6ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 15351-09-4 |
| Catalog No. | 2A-9036522 |
| Chinese Name | 甲胺苯丙酮 |
| Synonyms | Metamfepramona [Spanish]; Metamfepramone; Propiophenone,2-(dimethylamino); 2-dimethylamino-1-phenyl-1-propanone; 2-dimethylamino-1-phenyl-propan-1-one; N,N-dimethyl amino-2 propiophenone; (+-)-2-Dimethylamino-1-phenyl-propan-1-on; 1-Propanone,2-(dimethylamino)-1-phenyl; 2-(Dimethylamino)-1-phenyl-1-propanon; 2-(Dimethylamino)propiophenone; Dimepropion; Metamfepramonum [Latin]; Metamfepyramone; MG 559 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.24300 |
| Purity | 98.00 |
| Density | 0.995g/cm3 |
| Boiling Point | 256.6ºC at 760 mmHg |
| HTC | 2922399090 |
| PubChem ID | 133697 |
| SMILES | CC(C(=O)c1ccccc1)N(C)C |
| InChI | InChI=1S/C11H15NO/c1-9(12(2)3)11(13)10-7-5-4-6-8-10/h4-9H,1-3H3 |
| InChI Key | KBHMHROOFHVLBA-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tin(II) phthalocyanine | 15304-57-1 | 2A-9036510 |
| N-Nitroso-N-phenylhydroxylamine aluminum salt | 15305-07-4 | 2A-9036511 |
| Nickel diisobutyldithiocarbamate | 15317-78-9 | 2A-9036516 |
| 1-(1,1,2,3,3,6-Hexamethyl-2,3-dihydro-1H-inden-5-yl)ethanone | 15323-35-0 | 2A-9036518 |
| 5,6-Dehydrokawain | 15345-89-8 | 2A-9036521 |
| 4-Bromonicotinic acid | 15366-62-8 | 2A-9036528 |
| 2-(2,2,3-Trimethyl-1-cyclopent-3-enyl)acetonitrile | 15373-31-6 | 2A-9036529 |
| Manganese disodium EDTA trihydrate | 15375-84-5 | 2A-9036530 |
| 3-Isocyanatopropyltrimethoxysilane | 15396-00-6 | 2A-9036533 |
| 1-(2-Methoxyphenyl)-2-propylamine | 15402-84-3 | 2A-9036537 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA