
CAS Number15291-77-7
Synonymsginkgolide b from ginkgo biloba leaves; 7-DEOXYGINKGOLIDE C; 3-tert-butyl hexahydro-4,-7b-11 hydroxy-8-methyl; MFCD05662347; ginkgolide B from ginkgo leaves; GinkgolideB
Molecular FormulaC20H24O10
Molecular Weight424.399
Purity98.00%
Density1.6±0.1 g/cm3
Boiling Point762.4±60.0 °C at 760 mmHg
Melting Point280°C (dec.)
Appearancewhite crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 15291-77-7 |
| Catalog No. | 2A-9036505 |
| Chinese Name | 银杏内酯B |
| Synonyms | ginkgolide b from ginkgo biloba leaves; 7-DEOXYGINKGOLIDE C; 3-tert-butyl hexahydro-4,-7b-11 hydroxy-8-methyl; MFCD05662347; ginkgolide B from ginkgo leaves; GinkgolideB |
| Molecular Formula | C20H24O10 |
| Molecular Weight | 424.399 |
| Purity | 98.00 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 762.4±60.0 °C at 760 mmHg |
| Melting Point | 280°C (dec.) |
| Appearance | white crystal powder |
| Storage Condition | 2-8°C |
| Application | Ginkgolide B is a terpenoid and one of the important active substances in Ginkgo leaves. |
| PubChem ID | 14905024 |
| SMILES | CC1C(=O)OC2C(O)C34C5CC(C(C)(C)C)C36C(OC(=O)C6O)OC4(C(=O)O5)C12O |
| InChI | InChI=1S/C20H24O10/c1-6-12(23)28-11-9(21)18-8-5-7(16(2,3)4)17(18)10(22)13(24)29-15(17)30-20(18,14(25)27-8)19(6,11)26/h6-11,15,21-22,26H,5H2,1-4H3/t6-,7+,8-,9-,10+,11+,15+,17+,18+,19-,20-/m1/s1 |
| InChI Key | SQOJOAFXDQDRGF-OUKFJUMTSA-N |
| MSDS | msds/36505_1_15291_77_7.pdf |
| Transport Info | Product name: Ginkgolide B |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| 2-Nitrophenyl 2-acetamido-2-deoxy-beta-D-glucopyranoside | 13264-92-1 | 2A-9035463 |
| Oleanolic acid beta-D-glucopyranosyl ester | 14162-53-9 | 2A-9036032 |
| Anthocyanin | 18466-51-8 | 2A-9036066 |
| Isochlorogenic acid B | 14534-61-3 | 2A-9036247 |
| Phenylethyl beta-D-galactopyranoside | 14861-16-6 | 2A-9036362 |
| 5-Bromo-4-chloro-3-indolyl-beta-D-glucoside | 15548-60-4 | 2A-9036579 |
| 11-Keto-beta-boswellic acid | 17019-92-0 | 2A-9037344 |
| Swertiamarine | 17388-39-5 | 2A-9037474 |
| Methyl 2,3,4,6-tetra-O-benzyl-alpha-D-glucopyranoside | 17791-37-6 | 2A-9037631 |
| Fluorescein di(beta-D-galactopyranoside) | 17817-20-8 | 2A-9037643 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA