
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 15248-39-2 |
| Catalog No. | 2A-9036492 |
| Chinese Name | 6,7-二甲氧基异喹啉 |
| Synonyms | 6,7-Dimethoxyisoquinoline |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.216 |
| Purity | 98.00 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 319.9±22.0 °C at 760 mmHg |
| Melting Point | 92.0 to 96.0 °C |
| Appearance | off-white solid |
| Water Solubility | Soluble in: methanol |
| Storage Condition | room temperature |
| HTC | 2933499090 |
| PubChem ID | 11539 |
| MDL Number | MFCD00666134 |
| SMILES | COc1cc2ccncc2cc1OC |
| InChI | InChI=1S/C11H11NO2/c1-13-10-5-8-3-4-12-7-9(8)6-11(10)14-2/h3-7H,1-2H3 |
| InChI Key | JAJVYESKUNMYPN-UHFFFAOYSA-N |
| MSDS | msds/36492_1_15248_39_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 6,7-Dimethoxyisoquinoline Modification number: 5 |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-Nitro-3-hydroxypyridine | 15128-08-2 | 2A-9036457 |
| 3-Hydroxy-6-methyl-2-nitropyridine | 15128-90-2 | 2A-9036460 |
| 4,7-Dibromo-2,1,3-benzothiadiazole | 15155-41-6 | 2A-9036463 |
| 4-Morpholinecarbonyl chloride | 15159-40-7 | 2A-9036464 |
| 1-Ethyl-1H-1,2,3,4-tetrazole-5-thiol | 15217-53-5 | 2A-9036486 |
| 4,5-Dibromo-1H-1,2,3-triazole | 15294-81-2 | 2A-9036507 |
| Methyl 1H-pyrazole-3-carboxylate | 15366-34-4 | 2A-9036527 |
| 1,2,3,5-Tetra-O-benzoyl-2-C-methyl-beta-D-ribofuranose | 15397-15-6 | 2A-9036535 |
| 2-C-Methyl-alpha-D-ribofuranose tetrabenzoate | 15397-16-7 | 2A-9036536 |
| 4-Chloro-2,6-dimethyl-3-nitropyridine | 15513-48-1 | 2A-9036569 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA