
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 15071-34-8 |
| Catalog No. | 2A-9036434 |
| Chinese Name | (S)-2,3-二甲基丁酸 |
| Synonyms | Butanoic acid,2,3-dimethyl; 2,3-dimethylbutyric acid |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 |
| Purity | 98.00 |
| Density | 0.944 |
| Boiling Point | 191ºC |
| Storage Condition | 2-8℃ |
| HTC | 2915900090 |
| PubChem ID | 595273 |
| SMILES | CC(C)C(C)C(=O)O |
| InChI | InChI=1S/C6H12O2/c1-4(2)5(3)6(7)8/h4-5H,1-3H3,(H,7,8)/t5-/m0/s1 |
| InChI Key | XFOASZQZPWEJAA-YFKPBYRVSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (S)-(-)-1-Phenylethyl isocyanate | 14649-03-7 | 2A-9036304 |
| 3-Amino-4(3H)-quinazolinone | 14663-46-8 | 2A-9036308 |
| (4-Oxo-3(4H)-quinazolinyl)acetic acid | 14663-53-7 | 2A-9036309 |
| 4-Methylcinnoline | 14722-38-4 | 2A-0200216 |
| (R)-3-Amino-4-[(3-aminopropyl)amino]-4-oxobutanoic acid dihydrochloride | 14886-19-2 | 2A-9036371 |
| 4-tert-Butylbenzenesulfonyl chloride | 15084-51-2 | 2A-9036437 |
| (R)-2-(2,4-Dichlorophenoxy)propanoic acid | 15165-67-0 | 2A-9036468 |
| 2-tert-Butoxycarbonylamino-4-carbamoylbutyric acid 4-nitrophenyl ester | 15387-45-8 | 2A-9036532 |
| (R)-(+)-Propylene oxide | 15448-47-2 | 2A-9036547 |
| (R)-2-Methylbutane-1,4-diamine | 15657-58-6 | 2A-9036609 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA