
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14930-96-2 |
| Catalog No. | 2A-9036392 |
| Chinese Name | 细胞松弛素 B |
| Synonyms | EINECS 239-000-2; Phomin; Cytochalasin B; MFCD00077704 |
| Molecular Formula | C29H37NO5 |
| Molecular Weight | 479.61 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 740.6±60.0 °C at 760 mmHg |
| Melting Point | 218-223ºC |
| Appearance | powder |
| Water Solubility | ethanol: 20 mg/mL |
| Storage Condition | −20°C |
| Packaging | I |
| Application | Cytochalasin B is a cell-permeable mycotoxin that binds to the barbed ends of actin filaments and disrupts the formation of actin polymers. The Kd value for F-actin is 1.4-2.2 nM. |
| HTC | 29349990 |
| PubChem ID | 329774749 |
| SMILES | C=C1C(C)C2C(Cc3ccccc3)NC(=O)C23OC(=O)C=CC(O)CCCC(C)CC=CC3C1O |
| InChI | InChI=1S/C29H37NO5/c1-18-9-7-13-22(31)15-16-25(32)35-29-23(14-8-10-18)27(33)20(3)19(2)26(29)24(30-28(29)34)17-21-11-5-4-6-12-21/h4-6,8,11-12,14-16,18-19,22-24,26-27,31,33H,3,7,9-10,13,17H2,1-2H3,(H,30,34)/b14-8+,16-15+/t18-,19-,22-,23+,24+,26+,27-,29-/m1/s1 |
| InChI Key | GBOGMAARMMDZGR-TYHYBEHESA-N |
| Hazard Symbols | 6.1(a) |
| Bioactivity | Chemical & Physical Properties |
| Use of | Cytochalasin B is a cell-permeable mycotoxin binding to the barbed end of actin filaments, disrupting the formation of actin polymers, with Kd value of 1.4-2.2 nM for F-actin. Properties Articles67 Biological Activity Chemical & Physical Properties |
| Transport Info | Product name: Cytochalasin B |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl isonicotinate N-oxide | 14906-37-7 | 2A-9036379 |
| trans-Dichlorodiamineplatinum(II) | 14913-33-8 | 2A-9036382 |
| 3-Octyn-1-ol | 14916-80-4 | 2A-9036387 |
| Copper(II) 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-hexadecafluoro-29H,31H-phthalocyanine | 14916-87-1 | 2A-9036388 |
| 3-Formylbut-2-enyl acetate | 14918-80-0 | 2A-9036389 |
| N-Dodecyl-N,N-dimethyl-3-ammonio-1-propanesulfonate | 14933-08-5 | 2A-9036393 |
| 3-(N,N-Dimethylmyristylammonio)propanesulfonate | 14933-09-6 | 2A-9036394 |
| 3-Chloro-4-hydroxy-1H-quinolin-2-one | 14933-25-6 | 2A-9036395 |
| Cetyltributylphosphonium bromide | 14937-45-2 | 2A-9036397 |
| 4-Nitrophenyl-N-acetyl-beta-D-galactosaminide | 14948-96-0 | 2A-9036400 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA