
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14641-93-1 |
| Catalog No. | 2A-9036297 |
| Chinese Name | 乳糖单水合物 |
| Synonyms | EINECS 238-691-8; MFCD00150747 |
| Molecular Formula | C12H22O11 |
| Molecular Weight | 342.3 |
| Purity | 98.00 |
| Density | 1.76 g/cm3 |
| Boiling Point | 667.9ºC at 760 mmHg |
| Melting Point | 201-202ºC |
| Appearance | White fine crystals |
| Storage Condition | Keep sealed |
| Application | Alpha-Lactose is the main sugar in milk. Lactose exists as two isomers, α and β. The alpha form usually crystallizes as the monohydrate. |
| HTC | 1702190000 |
| PubChem ID | 7887889 |
| MDL Number | MFCD00064074 |
| SMILES | OCC1OC(OC2C(CO)OC(O)C(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-,11+,12+/m1/s1 |
| InChI Key | GUBGYTABKSRVRQ-XLOQQCSPSA-N |
| MSDS | msds/36297_1_14641_93_1.pdf |
| Use of | α-Lactose (α-D-Lactose) is the major sugar present in milk. Lactose exists in the form of two anomers, α and β. The α form normally crystallizes as a monohydrate[1][2]. Properties Biological Activity Chemical & Physical Properties Safety Info |
| Transport Info | Product name: Lactose monohydrate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5,6,7,8-Tetrahydroquinolin-8-ol | 14631-46-0 | 2A-9036291 |
| Cyclopropyl phenyl sulfide | 14633-54-6 | 2A-9036292 |
| Zinc ethylphenyl dithiocarbamate | 14634-93-6 | 2A-9036293 |
| Vitamin-E | 14638-18-7 | 2A-9036295 |
| Chromium picolinate | 14639-25-9 | 2A-9036296 |
| Gallium 8-hydroxyquinolinate | 14642-34-3 | 2A-9036298 |
| Benzyloxytrimethylsilane | 14642-79-6 | 2A-9036299 |
| Zinc acrylate | 14643-87-9 | 2A-9036300 |
| 1,2-Bis(diphenylphosphino)ethane nickel(II) chloride | 14647-23-5 | 2A-9036302 |
| 3-Hydroxyphenylphosphinyl-propanoic acid | 14657-64-8 | 2A-9036305 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA