
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14548-46-0 |
| Catalog No. | 2A-9036259 |
| Chinese Name | 4-苯甲酰吡啶 |
| Synonyms | MFCD00006430; Phenyl 4-Pyridyl Ketone; Phenyl(pyridin-4-yl)methanone; EINECS 238-586-7 |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 |
| Purity | 98.00 |
| Density | 1.139 g/cm3 |
| Boiling Point | 315 °C |
| Melting Point | 68-72 °C |
| Appearance | off-white board |
| Water Solubility | insoluble |
| Storage Condition | This product should be sealed and stored at 4°C to |
| HTC | 2933399090 |
| PubChem ID | 74966 |
| MDL Number | C12H9NO |
| SMILES | O=C(c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C12H9NO/c14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11/h1-9H |
| InChI Key | SKFLCXNDKRUHTA-UHFFFAOYSA-N |
| MSDS | msds/36259_1_14548_46_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 99.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 8-Hydroxyquinoline potassium sulfate | 14534-95-3 | 2A-9036248 |
| 3-Deoxy-3-fluoro-D-xylofuranose | 14537-01-0 | 2A-9036249 |
| Piperazine phosphate | 14538-56-8 | 2A-9036250 |
| Methyl 4-methylthiazole-2-carboxylate | 14542-15-5 | 2A-9036253 |
| 4-Methylthiazole-2-carboxylic acid | 14542-16-6 | 2A-9036254 |
| 5-Aminothiophene-2-carboxylic acid methyl ester | 14597-58-1 | 2A-9036277 |
| 3-(Aminomethyl)-1-methylpiperidine | 14613-37-7 | 2A-9036283 |
| 2-Chloropyrimidine-4,5-diamine | 14631-08-4 | 2A-9036288 |
| 2,3,5-Trimethylpyrazine | 14667-55-1 | 2A-9036313 |
| 5-Amino-1-(4-methoxyphenyl)-1H-pyrazole-4-carboxylic acid | 14678-95-6 | 2A-9036316 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA