
CAS Number13940-96-0
Synonyms4-phenoxy-1,2-diaminobenzene; 3,4-Diaminodiphenyl ether; 2-Amino-4-phenoxyaniline; 1,2-diamino-4-phenoxybenzene; 4-Phenoxy-o-phenylendiamin; 4-phenoxy-1,2-phenylenediamine; 4-phenoxy-o-phenylenediamine; 4-Phenoxy-1,2-benzenediamine
Molecular FormulaC12H12N2O
Molecular Weight200.24
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point365.2±27.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13940-96-0 |
| Catalog No. | 2A-9035924 |
| Chinese Name | 3,4-二氨基二苯醚 |
| Synonyms | 4-phenoxy-1,2-diaminobenzene; 3,4-Diaminodiphenyl ether; 2-Amino-4-phenoxyaniline; 1,2-diamino-4-phenoxybenzene; 4-Phenoxy-o-phenylendiamin; 4-phenoxy-1,2-phenylenediamine; 4-phenoxy-o-phenylenediamine; 4-Phenoxy-1,2-benzenediamine |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 365.2±27.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, protected from light, stored in inert gas |
| HTC | 2922299090 |
| PubChem ID | 15687646 |
| SMILES | Nc1ccc(Oc2ccccc2)cc1N |
| InChI | InChI=1S/C12H12N2O/c13-11-7-6-10(8-12(11)14)15-9-4-2-1-3-5-9/h1-8H,13-14H2 |
| InChI Key | FJVIHKKXPLPDSV-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Oxyvanadium phthalocyanine | 13930-88-6 | 2A-9035914 |
| Cupric chloride dihydrate | 13933-17-0 | 2A-9035915 |
| Tetraammineplatinum(II) chloride hydrate | 13933-32-9 | 2A-9035917 |
| 2-Pentyl-9,10-anthracenedione | 13936-21-5 | 2A-9035919 |
| Molybdenum hexacarbonyl | 13939-06-5 | 2A-9035921 |
| 2-(1-Naphthalenyloxy)propanoic acid | 13949-67-2 | 2A-9035926 |
| 2-Methyldiphenyl sulfide | 13963-35-4 | 2A-9035934 |
| Bis(ethylenediamine)palladium(II) chloride | 13963-53-6 | 2A-9035935 |
| Aluminum acetylacetonate | 13963-57-0 | 2A-9035936 |
| Potassium dicyanoaurate | 13967-50-5 | 2A-9035939 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA