
CAS Number13794-14-4
SynonymsEINECS 237-449-9; Butyric acid,2-phenoxy; DL-2-Phenoxybutyric acid; Butanoic acid,2-phenoxy; 2-Phenoxy-butyric acid; phenoxybutyric acid; MFCD00002666; (2RS)-2-phenoxybutyric acid
Molecular FormulaC10H12O3
Molecular Weight180.2
Purity98.00%
Density1.14 g/cm3
Boiling Point258ºC
Melting Point79-83ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13794-14-4 |
| Catalog No. | 2A-9035853 |
| Chinese Name | 2-苯氧基丁酸 |
| Synonyms | EINECS 237-449-9; Butyric acid,2-phenoxy; DL-2-Phenoxybutyric acid; Butanoic acid,2-phenoxy; 2-Phenoxy-butyric acid; phenoxybutyric acid; MFCD00002666; (2RS)-2-phenoxybutyric acid |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.2 |
| Purity | 98.00 |
| Density | 1.14 g/cm3 |
| Boiling Point | 258ºC |
| Melting Point | 79-83ºC |
| HTC | 2918990090 |
| PubChem ID | 3136062 |
| MDL Number | MFCD00002666 |
| SMILES | CCC(Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C10H12O3/c1-2-9(10(11)12)13-8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,11,12) |
| InChI Key | TVSPPYGAFOVROT-UHFFFAOYSA-N |
| MSDS | msds/35853_1_13794_14_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| tert-Butyl 4-methylbenzoate | 13756-42-8 | 2A-9035834 |
| 3-Bromo-1-fluoronaphthalene | 13772-59-3 | 2A-9035842 |
| Hydrazinium bromide | 13775-80-9 | 2A-9035846 |
| Aluminum metaphosphate | 13776-88-0 | 2A-9035847 |
| Diamminedichloropalladium | 13782-33-7 | 2A-9035851 |
| Terbium(III) chloride hexahydrate | 13798-24-8 | 2A-9035855 |
| Protizinic acid | 13799-03-6 | 2A-9035856 |
| 2,5-Dichloroterephthalic acid | 13799-90-1 | 2A-9035857 |
| Tetrakis(diethylamino)zirconium | 13801-49-5 | 2A-9035858 |
| 4-Methyl-2-hexanamine hydrochloride | 13803-74-2 | 2A-9035860 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA