
CAS Number13749-61-6
SynonymsN-Isopropyl-methacrylamid; EINECS 237-331-7; Methacrylsaeure-isopropylamid; N-Isopropylmethacrylamide; N-isopropyl-methacrylic acid amide; MFCD00192246
Molecular FormulaH2C=C(CH3)CONHCH(CH3)2
Molecular Weight127.18
Purity97%
Density0.875 g/cm3
Boiling Point241.1ºC at 760 mmHg
Melting Point89-91 °C (lit.)
AppearanceSolid;White to Orange to Green powder to crystal
EINECS237-331-7
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13749-61-6 |
| Catalog No. | 2A-9035824 |
| Chinese Name | N-异丙基甲基丙烯酰胺 |
| Synonyms | N-Isopropyl-methacrylamid; EINECS 237-331-7; Methacrylsaeure-isopropylamid; N-Isopropylmethacrylamide; N-isopropyl-methacrylic acid amide; MFCD00192246 |
| Molecular Formula | H2C=C(CH3)CONHCH(CH3)2 |
| Molecular Weight | 127.18 |
| Purity | 97 |
| Density | 0.875 g/cm3 |
| Boiling Point | 241.1ºC at 760 mmHg |
| Melting Point | 89-91 °C (lit.) |
| Appearance | Solid;White to Orange to Green powder to crystal |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Room temperature, dry, sealed |
| EINECS | 237-331-7 |
| HTC | 2924199090 |
| PubChem ID | 24866505 |
| MDL Number | MFCD00192246 |
| SMILES | CC(C)NC(=O)C(C)=C |
| InChI | 1S/C7H13NO/c1-5(2)7(9)8-6(3)4/h6H,1H2,2-4H3,(H,8,9) |
| InChI Key | YQIGLEFUZMIVHU-UHFFFAOYSA-N |
| NACRES Code | NA.23 |
| UNSPSC | 12162002 |
| MSDS | msds/35824_1_13749_61_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,5-Dibromoterephthalic acid | 13731-82-3 | 2A-9035806 |
| Sodium 4-formylbenzenesulfonate | 13736-22-6 | 2A-9035813 |
| 3-[(4-Methoxyphenyl)thio]propanoic acid | 13739-36-1 | 2A-9035817 |
| 11-Chloro-dibenzo[b,f][1,4]thiazepine | 13745-86-3 | 2A-9035820 |
| Zirconium tetranitrate | 13746-89-9 | 2A-9035822 |
| tert-Butyl 4-methylbenzoate | 13756-42-8 | 2A-9035834 |
| 3-Bromo-1-fluoronaphthalene | 13772-59-3 | 2A-9035842 |
| Hydrazinium bromide | 13775-80-9 | 2A-9035846 |
| Aluminum metaphosphate | 13776-88-0 | 2A-9035847 |
| Diamminedichloropalladium | 13782-33-7 | 2A-9035851 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA