
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13490-69-2 |
| Catalog No. | 2A-9035645 |
| Chinese Name | (S)-3-甲基-2-苯基丁酸 |
| Synonyms | S-2-hydroxybutyric acid; L-2-hydroxybutyric acid; 2S-Hydroxybutanoic acid; 2-Hydroxybutyrate |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 |
| Purity | 98.00 |
| Density | 1.063g/cm3 |
| Boiling Point | 282ºC at 760 mmHg |
| Melting Point | 86-88ºC |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2916399090 |
| PubChem ID | 15389038 |
| SMILES | CC(C)C(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C11H14O2/c1-8(2)10(11(12)13)9-6-4-3-5-7-9/h3-8,10H,1-2H3,(H,12,13)/t10-/m0/s1 |
| InChI Key | HDLQGISFYDYWFJ-JTQLQIEISA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Hydroxy-4-amino butanoic acid | 13477-53-7 | 2A-9035634 |
| Copper glycinate | 13479-54-4 | 2A-9035639 |
| 4-Hydroxycyclohexanone | 13482-22-9 | 2A-9035641 |
| 4-Methoxycyclohexanon | 13482-23-0 | 2A-9035642 |
| L-Alanyl-L-proline | 13485-59-1 | 2A-9035644 |
| (alphaR)-alpha-(1-Methylethyl)benzeneacetic acid | 13491-13-9 | 2A-9035646 |
| 3,4-Dimethyl-1,2-cyclopentanedione | 13494-06-9 | 2A-9035647 |
| 3,5-Dimethyl-1,2-cyclopentanedione | 13494-07-0 | 2A-9035648 |
| Bis[3-(triethoxysilyl)propyl]amine | 13497-18-2 | 2A-9035649 |
| (3-Chloropropyl)diethoxymethylsilane | 13501-76-3 | 2A-9035651 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA