
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13472-58-7 |
| Catalog No. | 2A-9035625 |
| Chinese Name | 2-甲氧基-3,5-二氯吡啶 |
| Synonyms | 3,5-Dichloro-2-methoxypyridine |
| Molecular Formula | C6H5Cl2NO |
| Molecular Weight | 178.016 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 199.7±35.0 °C at 760 mmHg |
| Melting Point | 90ºC |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933399090 |
| PubChem ID | 35920485 |
| SMILES | COc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C6H5Cl2NO/c1-10-6-5(8)2-4(7)3-9-6/h2-3H,1H3 |
| InChI Key | XMASGFYUZZRWOE-UHFFFAOYSA-N |
| MSDS | msds/35625_1_13472_58_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5-Methoxybenzofuran | 13391-28-1 | 2A-9035550 |
| 2,2'-((1-Methylethylidene)bis(cyclohexane-4,1-diyloxymethylene))bisoxirane | 13410-58-7 | 2A-9035563 |
| 1-Ethyl-3-hydroxypiperidine | 13444-24-1 | 2A-9035585 |
| 2-Methyl-1,3-benzoxazole-6-carboxylic acid | 13452-14-7 | 2A-9035596 |
| 3-Bromo-2-hydroxypyridine | 13466-43-8 | 2A-9035620 |
| 3-Bromo-2-methoxypyridine | 13472-59-8 | 2A-9035626 |
| 5-Chloro-2-methoxypyridine | 13473-01-3 | 2A-9035630 |
| 1-(2-Methoxyethyl)piperazine | 13484-40-7 | 2A-9035643 |
| 3-Fluoro-4-nitropyridine | 13505-01-6 | 2A-9035653 |
| 3-Amino-4-nitropyridine | 13505-02-7 | 2A-9035654 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA