
CAS Number13361-30-3
SynonymsPropan-2-yl cyanoacetate; Propan-2-ylcyanacetat; Acetic acid, 2-cyano-, 1-methylethyl ester; Cyanoacetic Acid Isopropyl Ester; Isopropyl cyanoacetate; propan-2-yl 2-cyanoacetate; EINECS 236-421-3; MFCD00019842
Molecular FormulaC6H9NO2
Molecular Weight127.144
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point194.5±8.0 °C at 760 mmHg
Appearancecolorless liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13361-30-3 |
| Catalog No. | 2A-9035531 |
| Chinese Name | 氰基乙酸异丙酯 |
| Synonyms | Propan-2-yl cyanoacetate; Propan-2-ylcyanacetat; Acetic acid, 2-cyano-, 1-methylethyl ester; Cyanoacetic Acid Isopropyl Ester; Isopropyl cyanoacetate; propan-2-yl 2-cyanoacetate; EINECS 236-421-3; MFCD00019842 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.144 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 194.5±8.0 °C at 760 mmHg |
| Appearance | colorless liquid |
| Storage Condition | Sealed at room temperature, cool, ventilated and d |
| HTC | 2926909090 |
| PubChem ID | 67929 |
| MDL Number | MFCD00019842 |
| SMILES | CC(C)OC(=O)CC#N |
| InChI | InChI=1S/C6H9NO2/c1-5(2)9-6(8)3-4-7/h5H,3H2,1-2H3 |
| InChI Key | BESQLCCRQYTQQI-UHFFFAOYSA-N |
| MSDS | msds/35531_1_13361_30_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5,9-Methano-6,7,8,9-tetrahydro-7H-benzocycloheptene-7-one | 13351-26-3 | 2A-9035524 |
| 2,2-Dimethyl-3-phenyl-1-propanol | 13351-61-6 | 2A-9035525 |
| Butylchlorodihydroxytin | 13355-96-9 | 2A-9035526 |
| Dimethylsulfamoyl chloride | 13360-57-1 | 2A-9035528 |
| Ethylbutylamine | 13360-63-9 | 2A-9035529 |
| Isobutyl cyanoacetate | 13361-31-4 | 2A-9035532 |
| Allyl cyanoacetate | 13361-32-5 | 2A-9035533 |
| 2-Ethylhexyl cyanoacetate | 13361-34-7 | 2A-9035534 |
| Trimethyl(propargyl)silane | 13361-64-3 | 2A-9035535 |
| Ethyl 2-aminoisonicotinate | 13362-30-6 | 2A-9035538 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA